(4R)-1-(tert-Butoxycarbonyl)-4-methyl-L-proline structure
|
Common Name | (4R)-1-(tert-Butoxycarbonyl)-4-methyl-L-proline | ||
|---|---|---|---|---|
| CAS Number | 364750-80-1 | Molecular Weight | 229.273 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 343.2±35.0 °C at 760 mmHg | |
| Molecular Formula | C11H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.4±25.9 °C | |
| Name | (2S,4R)-4-methyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 343.2±35.0 °C at 760 mmHg |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.273 |
| Flash Point | 161.4±25.9 °C |
| Exact Mass | 229.131409 |
| PSA | 66.84000 |
| LogP | 1.05 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.491 |
| InChIKey | MXKSXPYZNXUHEZ-SFYZADRCSA-N |
| SMILES | CC1CC(C(=O)O)N(C(=O)OC(C)(C)C)C1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (4R)-1-Boc-4-Methyl-L-proline |
| N-tert-butyloxycarbonyl-(2S,4R)-4-methylproline |
| (4R)-4-Methyl-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-proline |
| (2S,4R)-N-tert-butyloxycarbonyl-4-methylproline |
| (2S,4R)-1-(TERT-BUTOXYCARBONYL)-4-METHYLPYRROLIDINE-2-CARBOXYLIC ACID |
| trans-1-(tert-Butoxycarbonyl)-4-methyl-L-proline |
| 1,2-Pyrrolidinedicarboxylic acid, 4-methyl-, 1-(1,1-dimethylethyl) ester, (2S,4R)- |
| (4R)-1-(tert-Butoxycarbonyl)-4-methyl-L-proline |