Boc-Hyp-OH structure
|
Common Name | Boc-Hyp-OH | ||
|---|---|---|---|---|
| CAS Number | 13726-69-7 | Molecular Weight | 231.246 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 390.9±42.0 °C at 760 mmHg | |
| Molecular Formula | C10H17NO5 | Melting Point | 123-127 °C(lit.) | |
| MSDS | USA | Flash Point | 190.2±27.9 °C | |
Use of Boc-Hyp-OHBoc-Hyp-OH is a non-cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Boc-Hyp-OH is also a alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1][2] |
| Name | Boc-L-Hydroxyproline |
|---|---|
| Synonym | More Synonyms |
| Description | Boc-Hyp-OH is a non-cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Boc-Hyp-OH is also a alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1][2] |
|---|---|
| Related Catalog | |
| Target |
Non-cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker[1]. PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[2]. |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 390.9±42.0 °C at 760 mmHg |
| Melting Point | 123-127 °C(lit.) |
| Molecular Formula | C10H17NO5 |
| Molecular Weight | 231.246 |
| Flash Point | 190.2±27.9 °C |
| Exact Mass | 231.110672 |
| PSA | 87.07000 |
| LogP | -0.71 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.531 |
| InChIKey | BENKAPCDIOILGV-RQJHMYQMSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(O)CC1C(=O)O |
| Storage condition | -20°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xn |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933990090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,2-Pyrrolidinedicarboxylic acid, 4-hydroxy-, 1-(1,1-dimethylethyl) ester, (2S)- |
| trans-N-(tert-Butoxycarbonyl)-4-hydroxy-L-proline |
| BOC-HYP-OH |
| N-ter |
| trans-Boc-Hyp-OH |
| BOC-L-HYP-OH |
| BOC-HYP |
| N-BOC-L-Hydroxyproline |
| RARECHEM EM WB 0136 |
| trans-N-tert-Butoxycarbonyl-4-hydroxy-l-proline |
| BOC-L-4-HYDROXYPROLINE |
| BOC-trans-4-hydroxy-L-proline |
| BOC-TRANS-HYP-OH |
| 1,2-Pyrrolidinedicarboxylic acid, 4-hydroxy-, 1-(1,1-dimethylethyl) ester, (2S,4R)- |
| (2S,4R)-1-(tert-Butoxycarbonyl)-4-hydroxypyrrolidine-2-carboxylic acid |
| MFCD00053370 |
| trans-N-Boc-4-hydroxy-L-proline |
| BOC-HYDROXYPROLINE |
| (4R)-4-Hydroxy-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-proline |
| 4-Hydroxy-1-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-proline |
| 1-(tert-Butoxycarbonyl)-4-hydroxy-L-proline |