Ethanone,2-(dimethylamino)-1,2-diphenyl
Ethanone,2-(dimethylamino)-1,2-diphenyl structure
|
Common Name | Ethanone,2-(dimethylamino)-1,2-diphenyl | ||
|---|---|---|---|---|
| CAS Number | 36713-33-4 | Molecular Weight | 239.31200 | |
| Density | 1.074g/cm3 | Boiling Point | 346.6ºC at 760mmHg | |
| Molecular Formula | C16H17NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 122.2ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(dimethylamino)-1,2-diphenylethanone |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.074g/cm3 |
|---|---|
| Boiling Point | 346.6ºC at 760mmHg |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.31200 |
| Flash Point | 122.2ºC |
| Exact Mass | 239.13100 |
| PSA | 20.31000 |
| LogP | 3.17220 |
| Index of Refraction | 1.576 |
| InChIKey | FFXYYGZTOUQTBO-UHFFFAOYSA-N |
| SMILES | CN(C)C(C(=O)c1ccccc1)c1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 9 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-dimethylamino-1,2-diphenyl-ethanone |
| ms-Dimethylamino-desoxybenzoin |
| Dimethyldesylamin |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-(dimethylamino)-1,2-diphenylethanone? |
| A: SMILES notation of 2-(dimethylamino)-1,2-diphenylethanone is CN(C)C(C(=O)c1ccccc1)c1ccccc1. |
| Q: What is the English name of 2-(dimethylamino)-1,2-diphenylethanone? |
| A: The English name of 2-(dimethylamino)-1,2-diphenylethanone is 2-(dimethylamino)-1,2-diphenylethanone. |
| Q: What are the upstream materials of 2-(dimethylamino)-1,2-diphenylethanone? |
| A: Related upstream materials(CAS) of 2-(dimethylamino)-1,2-diphenylethanone: 827-36-1;71-43-2;611-74-5;124-40-3;447-31-4;119-53-9;451-40-1;1585-74-6;64-17-5. |
| Q: What is the molecular formula of 2-(dimethylamino)-1,2-diphenylethanone? |
| A: Molecular formula of 2-(dimethylamino)-1,2-diphenylethanone is C16H17NO. |
| Q: What is the Chinese name of 36713-33-4? |
| A: Chinese name of 36713-33-4 is 36713-33-4. |
| Q: What is the LogP of 2-(dimethylamino)-1,2-diphenylethanone? |
| A: LogP of 2-(dimethylamino)-1,2-diphenylethanone is 3.17220. |
| Q: What is the boiling point of 2-(dimethylamino)-1,2-diphenylethanone? |
| A: Boiling point of 2-(dimethylamino)-1,2-diphenylethanone is 346.6ºC at 760mmHg. |
| Q: What is the molecular weight of 2-(dimethylamino)-1,2-diphenylethanone? |
| A: Molecular weight of 2-(dimethylamino)-1,2-diphenylethanone is 239.31200. |
| Q: What is the InChIKey of 2-(dimethylamino)-1,2-diphenylethanone? |
| A: InChIKey of 2-(dimethylamino)-1,2-diphenylethanone is FFXYYGZTOUQTBO-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 2-(dimethylamino)-1,2-diphenylethanone? |
| A: Polar surface area (PSA) of 2-(dimethylamino)-1,2-diphenylethanone is 20.31000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |