diethyl tetrahydrofurfurylmalonate structure
|
Common Name | diethyl tetrahydrofurfurylmalonate | ||
|---|---|---|---|---|
| CAS Number | 37136-39-3 | Molecular Weight | 244.28400 | |
| Density | 1.091g/cm3 | Boiling Point | 304.6ºC at 760mmHg | |
| Molecular Formula | C12H20O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 129.4ºC | |
| Name | diethyl 2-(oxolan-2-ylmethyl)propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.091g/cm3 |
|---|---|
| Boiling Point | 304.6ºC at 760mmHg |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.28400 |
| Flash Point | 129.4ºC |
| Exact Mass | 244.13100 |
| PSA | 61.83000 |
| LogP | 1.29790 |
| Index of Refraction | 1.454 |
| InChIKey | DNNUDKVYVAZVKN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CC1CCCO1)C(=O)OCC |
| HS Code | 2932190090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 1 | |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Diethyl Tetrahydrofufurylmalonate |
| EINECS 253-357-1 |
| Tetrahydrofurfuryl-malonsaeure-diaethylester |
| Diethyl tetrahydrofurfurylmalonate |
| tetrahydrofurfuryl-malonic acid diethyl ester |
| diethyl 2-((tetrahydrofuran-2-yl)methyl)malonate |