1-chlorononafluorobutane
1-chlorononafluorobutane structure
|
Common Name | 1-chlorononafluorobutane | ||
|---|---|---|---|---|
| CAS Number | 558-89-4 | Molecular Weight | 254.48100 | |
| Density | 1.64g/cm3 | Boiling Point | 29ºC | |
| Molecular Formula | C4ClF9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-chloro-1,1,2,2,3,3,4,4,4-nonafluorobutane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.64g/cm3 |
|---|---|
| Boiling Point | 29ºC |
| Molecular Formula | C4ClF9 |
| Molecular Weight | 254.48100 |
| Exact Mass | 253.95400 |
| LogP | 3.65090 |
| Index of Refraction | 1.274 |
| InChIKey | GIUDNRMHWCAPGM-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 0 | |
CAS#:109-69-3
CAS#:423-39-2
CAS#:64773-40-6
CAS#:2314-97-8
CAS#:421-83-0
CAS#:2991-84-6
CAS#:375-17-7
CAS#:355-24-8
CAS#:423-31-4
CAS#:78-86-4This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| PC7881 |
| 1-Chlor-nonafluor-butan |
| 1-Chlorononafluorobutane |
| 1-Chloro-F-butane |
| chloro-1 de perfluorobutane |
| perfluorobutyl chloride |
| MFCD00798130 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1-chloro-1,1,2,2,3,3,4,4,4-nonafluorobutane? |
| A: InChIKey of 1-chloro-1,1,2,2,3,3,4,4,4-nonafluorobutane is GIUDNRMHWCAPGM-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1-chloro-1,1,2,2,3,3,4,4,4-nonafluorobutane? |
| A: Molecular formula of 1-chloro-1,1,2,2,3,3,4,4,4-nonafluorobutane is C4ClF9. |
| Q: What is the SMILES notation of 1-chloro-1,1,2,2,3,3,4,4,4-nonafluorobutane? |
| A: SMILES notation of 1-chloro-1,1,2,2,3,3,4,4,4-nonafluorobutane is FC(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl. |
| Q: What is the LogP of 1-chloro-1,1,2,2,3,3,4,4,4-nonafluorobutane? |
| A: LogP of 1-chloro-1,1,2,2,3,3,4,4,4-nonafluorobutane is 3.65090. |
| Q: What is the CAS number of 1-chloro-1,1,2,2,3,3,4,4,4-nonafluorobutane? |
| A: CAS number of 1-chloro-1,1,2,2,3,3,4,4,4-nonafluorobutane is 558-89-4. |
| Q: What English synonyms does 1-chloro-1,1,2,2,3,3,4,4,4-nonafluorobutane have? |
| A: English synonyms of 1-chloro-1,1,2,2,3,3,4,4,4-nonafluorobutane: PC7881, 1-Chlor-nonafluor-butan, 1-Chlorononafluorobutane, 1-Chloro-F-butane, chloro-1 de perfluorobutane, perfluorobutyl chloride, MFCD00798130. |
| Q: What are the upstream materials of 1-chloro-1,1,2,2,3,3,4,4,4-nonafluorobutane? |
| A: Related upstream materials(CAS) of 1-chloro-1,1,2,2,3,3,4,4,4-nonafluorobutane: 109-69-3;423-39-2;64773-40-6;2314-97-8;421-83-0;2991-84-6;375-17-7;355-24-8;423-31-4;78-86-4. |
| Q: What is the boiling point of 1-chloro-1,1,2,2,3,3,4,4,4-nonafluorobutane? |
| A: Boiling point of 1-chloro-1,1,2,2,3,3,4,4,4-nonafluorobutane is 29ºC. |
| Q: What is the molecular weight of 1-chloro-1,1,2,2,3,3,4,4,4-nonafluorobutane? |
| A: Molecular weight of 1-chloro-1,1,2,2,3,3,4,4,4-nonafluorobutane is 254.48100. |
| Q: What is the English name of 1-chloro-1,1,2,2,3,3,4,4,4-nonafluorobutane? |
| A: The English name of 1-chloro-1,1,2,2,3,3,4,4,4-nonafluorobutane is 1-chloro-1,1,2,2,3,3,4,4,4-nonafluorobutane. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |