1-bromoperfluoroheptane structure
|
Common Name | 1-bromoperfluoroheptane | ||
|---|---|---|---|---|
| CAS Number | 375-88-2 | Molecular Weight | 448.95500 | |
| Density | 1.894 g/mL at 25 °C(lit.) | Boiling Point | 118 °C(lit.) | |
| Molecular Formula | C7BrF15 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 117-119°C | |
| Name | 1-Bromopentadecafluoroheptane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.894 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 118 °C(lit.) |
| Molecular Formula | C7BrF15 |
| Molecular Weight | 448.95500 |
| Flash Point | 117-119°C |
| Exact Mass | 447.89400 |
| LogP | 5.71290 |
| Index of Refraction | n20/D 1.301(lit.) |
| InChIKey | VPQQZKWYZYVTMU-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Br |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| WGK Germany | 3 |
| HS Code | 2903799090 |
|
~%
1-bromoperfluor... CAS#:375-88-2 |
| Literature: US2647933 , ; |
|
~%
1-bromoperfluor... CAS#:375-88-2
Detail
|
| Literature: Journal of Organic Chemistry, , vol. 38, # 5 p. 907 - 909 |
|
~%
1-bromoperfluor... CAS#:375-88-2
Detail
|
| Literature: Journal of Organic Chemistry, , vol. 38, # 5 p. 907 - 909 |
| HS Code | 2903799090 |
|---|---|
| Summary | 2903799090 halogenated derivatives of acyclic hydrocarbons containing two or more different halogens。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| Perfluoroheptyl Bromide |
| MFCD00013570 |
| Pentadecafluoroheptyl BroMide |
| 1-bromo-1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptane |
| 1-Bromoperfluoroheptane |
| EINECS 206-799-4 |