1,5-Dibromo-2,2,3,3,4,4-hexafluoropentane structure
|
Common Name | 1,5-Dibromo-2,2,3,3,4,4-hexafluoropentane | ||
|---|---|---|---|---|
| CAS Number | 33619-78-2 | Molecular Weight | 337.88400 | |
| Density | 1.984g/cm3 | Boiling Point | 186.4ºC at 760mmHg | |
| Molecular Formula | C5H4Br2F6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 66.6ºC | |
| Name | 1,5-Dibromo-2,2,3,3,4,4-hexafluoropentane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.984g/cm3 |
|---|---|
| Boiling Point | 186.4ºC at 760mmHg |
| Molecular Formula | C5H4Br2F6 |
| Molecular Weight | 337.88400 |
| Flash Point | 66.6ºC |
| Exact Mass | 335.85800 |
| LogP | 3.68210 |
| Index of Refraction | 1.403 |
| InChIKey | QMSMXOXREPKYSH-UHFFFAOYSA-N |
| SMILES | FC(F)(CBr)C(F)(F)C(F)(F)CBr |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2903799090 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2903799090 |
|---|---|
| Summary | 2903799090 halogenated derivatives of acyclic hydrocarbons containing two or more different halogens。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 1,5-dibromo-2,2,3,3,4,4-hexafluoropentane |