Ammonium perfluorocaprilate structure
|
Common Name | Ammonium perfluorocaprilate | ||
|---|---|---|---|---|
| CAS Number | 3825-26-1 | Molecular Weight | 431.099 | |
| Density | 1,163 g/cm3 | Boiling Point | 188ºC at 760mmHg | |
| Molecular Formula | C8H4F15NO2 | Melting Point | 163-165(dec.) | |
| MSDS | Chinese USA | Flash Point | 62.1ºC | |
| Symbol |
GHS05, GHS06, GHS08 |
Signal Word | Danger | |
| Name | perfluorooctanoic acid ammonium salt |
|---|---|
| Synonym | More Synonyms |
| Density | 1,163 g/cm3 |
|---|---|
| Boiling Point | 188ºC at 760mmHg |
| Melting Point | 163-165(dec.) |
| Molecular Formula | C8H4F15NO2 |
| Molecular Weight | 431.099 |
| Flash Point | 62.1ºC |
| Exact Mass | 431.000244 |
| PSA | 40.54000 |
| LogP | 4.76900 |
| InChIKey | YOALFLHFSFEMLP-UHFFFAOYSA-N |
| SMILES | O=C([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[NH4+] |
| Water Solubility | H2O: 0.1 g/mL, clear, colorless |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS05, GHS06, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H318-H331-H351-H360-H362-H372 |
| Precautionary Statements | P201-P261-P263-P280-P305 + P351 + P338-P311 |
| Target Organs | Liver |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xn,Xi |
| Risk Phrases | R22;R36/38 |
| Safety Phrases | S26-S36 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 2 |
| RTECS | RH0782000 |
| Packaging Group | II |
| Hazard Class | 6.1(a) |
| HS Code | 2923900090 |
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| HS Code | 2923900090 |
|---|---|
| Summary | 2923900090 other quaternary ammonium salts and hydroxides。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Associations between perfluoroalkyl compounds and immune and clinical chemistry parameters in highly exposed bottlenose dolphins (Tursiops truncatus).
Environ. Toxicol. Chem. 32(4) , 736-46, (2013) Perfluoroalkyl compounds (PFCs) are ubiquitous, persistent chemical contaminants found in the environment, wildlife, and humans. Despite the widespread occurrence of PFCs, little is known about the im... |
|
|
Utilization of micellar electrokinetic chromatography-tandem mass spectrometry employed volatile micellar phase in the analysis of cathinone designer drugs.
J. Chromatogr. A. 1356 , 258-65, (2014) A micellar electrokinetic chromatography method with tandem mass spectrometry has been developed for the selective separation, identification and determination of twelve new designer drugs from the gr... |
|
|
Estrogenic compounds determination in water samples by dispersive liquid–liquid microextraction and micellar electrokinetic chromatography coupled to mass spectrometry
J. Chromatogr. A. 1344 , 109-21, (2014) • A NSM–MEKC–MS approach using APFO has been developed for the separation of 12 estrogens. • All parameters were carefully optimized, obtaining the separation in less than 11min. • A DLLME procedure w... |
| Pentadecafluorooctanoic acid ammonium salt |
| Ammonium Pentadecafluorooctanoate |
| azanium,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate |
| Perfluorocaprylic acid ammonium salt |
| Ammonium perfluorooctanoate |
| Ammonium perfluoro-n-octanoate |
| Ammonium perfluorocaprylate |
| Perfluoro-n-octanoic acid, ammonium salt |
| Pentadecafluorooctanoic acid ammoniate (1:1) |
| Perfluorooctanoic Acid Ammonium Salt |
| Perfluorooctanoic acid, ammonium salt |
| EINECS 223-320-4 |
| Ammonium perfluorocaprilate |
| Octanoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluoro-, ammonium salt |
| MFCD00042599 |