METHYL PERFLUOROOCTANOATE structure
|
Common Name | METHYL PERFLUOROOCTANOATE | ||
|---|---|---|---|---|
| CAS Number | 376-27-2 | Molecular Weight | 428.09500 | |
| Density | 1.786 g/mL at 25 °C(lit.) | Boiling Point | 159-160 °C(lit.) | |
| Molecular Formula | C9H3F15O2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 150 °F | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | methyl perfluorooctanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.786 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 159-160 °C(lit.) |
| Molecular Formula | C9H3F15O2 |
| Molecular Weight | 428.09500 |
| Flash Point | 150 °F |
| Exact Mass | 427.98900 |
| PSA | 26.30000 |
| LogP | 4.53350 |
| Index of Refraction | n20/D 1.305(lit.) |
| InChIKey | XOCNYZFAMHDXJK-UHFFFAOYSA-N |
| SMILES | COC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Hazard Codes | F: Flammable; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S24/25 |
| WGK Germany | 3 |
| RTECS | RH0783200 |
| HS Code | 2915900090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
|
Syntheses of perfluoroalkyl N-polyethoxylated amides. Afzal J, et al.
J. Fluor. Chem. 34(3) , 385-93, (1987)
|
|
|
Free energy relations in fluorocarbon-hydrocarbon systems. Kyle BG and Reed III TM.
J. Am. Chem. Soc. 80(23) , 6170-77, (1958)
|
|
|
Influence of perfluoroheptylcarbonylamino end groups on the surface properties of semi-crystalline poly (butylene isophthalate) polyesters. Synytska A, et al. Polymer Prepr. 47(2) , 534, (2006)
|
| methyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate |
| MFCD00039244 |
| Methyl Perfluorooctanoate |
| Pentadecafluorooctanoic Acid Methyl Ester |
| Methyl pentadecafluorooctanoate |
| Perfluorooctanoic Acid Methyl Ester |
| EINECS 206-808-1 |