Benzamide,N-(2-methoxy-4-nitrophenyl)- structure
|
Common Name | Benzamide,N-(2-methoxy-4-nitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 38259-78-8 | Molecular Weight | 272.25600 | |
| Density | 1.333g/cm3 | Boiling Point | 370.5ºC at 760 mmHg | |
| Molecular Formula | C14H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.9ºC | |
| Name | N-(2-methoxy-4-nitrophenyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.333g/cm3 |
|---|---|
| Boiling Point | 370.5ºC at 760 mmHg |
| Molecular Formula | C14H12N2O4 |
| Molecular Weight | 272.25600 |
| Flash Point | 177.9ºC |
| Exact Mass | 272.08000 |
| PSA | 84.15000 |
| LogP | 3.45190 |
| Index of Refraction | 1.645 |
| InChIKey | DEDKVZCXBHLLQO-UHFFFAOYSA-N |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)c1ccccc1 |
|
~60%
Benzamide,N-(2-... CAS#:38259-78-8 |
| Literature: Downer, Nadale K.; Jackson, Yvette A. Organic and Biomolecular Chemistry, 2004 , vol. 2, # 20 p. 3039 - 3043 |
|
~%
Benzamide,N-(2-... CAS#:38259-78-8 |
| Literature: Rajappa, Srinivasachari; Sreenivasan, Ramaswami; Khalwadekar, Asha Journal of Chemical Research, Miniprint, 1986 , # 5 p. 1657 - 1675 |
|
~%
Benzamide,N-(2-... CAS#:38259-78-8 |
| Literature: Meldola; Eyre Chem. News J. Ind. Sci., 1901 , vol. 83, p. 1076,285 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 5-Nitro-2-benzamino-phenol-methylaether |
| 5-Nitro-2-benzamino-anisol |
| ghl.PD_Mitscher_leg0.762 |