Formamide,N-(2-methoxy-4-nitrophenyl)- structure
|
Common Name | Formamide,N-(2-methoxy-4-nitrophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 71862-04-9 | Molecular Weight | 196.16000 | |
| Density | 1.38g/cm3 | Boiling Point | 446.4ºC at 760 mmHg | |
| Molecular Formula | C8H8N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.8ºC | |
| Name | N-(2-methoxy-4-nitrophenyl)formamide |
|---|
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 446.4ºC at 760 mmHg |
| Molecular Formula | C8H8N2O4 |
| Molecular Weight | 196.16000 |
| Flash Point | 223.8ºC |
| Exact Mass | 196.04800 |
| PSA | 84.15000 |
| LogP | 2.40380 |
| Index of Refraction | 1.61 |
| InChIKey | FUIUWHWBMOROGV-UHFFFAOYSA-N |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC=O |
| HS Code | 2924299090 |
|---|
|
~45%
Formamide,N-(2-... CAS#:71862-04-9 |
| Literature: Kobayashi, Genki; Saito, Tateo; Kitano, Yoshikazu Synthesis, 2011 , # 20 art. no. F54011SS, p. 3225 - 3234 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |