(-)-DIBUTYL-D-TARTRATE structure
|
Common Name | (-)-DIBUTYL-D-TARTRATE | ||
|---|---|---|---|---|
| CAS Number | 38270-72-3 | Molecular Weight | 266.24700 | |
| Density | 1.266g/cm3 | Boiling Point | 357.6ºC at 760mmHg | |
| Molecular Formula | C13H14O6 | Melting Point | 74-76ºC(lit.) | |
| MSDS | N/A | Flash Point | 157.3ºC | |
| Name | (-)-dimethyl 2,3-o-benzylidene-l-tartrate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.266g/cm3 |
|---|---|
| Boiling Point | 357.6ºC at 760mmHg |
| Melting Point | 74-76ºC(lit.) |
| Molecular Formula | C13H14O6 |
| Molecular Weight | 266.24700 |
| Flash Point | 157.3ºC |
| Exact Mass | 266.07900 |
| PSA | 71.06000 |
| LogP | 0.81520 |
| Index of Refraction | 1.515 |
| InChIKey | FMSYNRGOFIGJMM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1OC(c2ccccc2)OC1C(=O)OC |
| Safety Phrases | 22-24/25 |
|---|---|
| WGK Germany | 3 |
| HS Code | 2932999099 |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD00064474 |
| dimethyl 2,3-o-benzylidene-l-tartrate |