Boc-DL-serine structure
|
Common Name | Boc-DL-serine | ||
|---|---|---|---|---|
| CAS Number | 3850-40-6 | Molecular Weight | 205.208 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 385.1±37.0 °C at 760 mmHg | |
| Molecular Formula | C8H15NO5 | Melting Point | 92-94°C | |
| MSDS | N/A | Flash Point | 186.7±26.5 °C | |
| Name | N-(tert-butoxycarbonyl)-D-serine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 385.1±37.0 °C at 760 mmHg |
| Melting Point | 92-94°C |
| Molecular Formula | C8H15NO5 |
| Molecular Weight | 205.208 |
| Flash Point | 186.7±26.5 °C |
| Exact Mass | 205.095016 |
| PSA | 95.86000 |
| LogP | 0.22 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.486 |
| InChIKey | FHOAKXBXYSJBGX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CO)C(=O)O |
| Storage condition | 2-8°C |
| Water Solubility | 1 mmole in 2 ml DMF clearly soluble |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924199090 |
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Serine,N-[(1,1-dimethylethoxy)carbonyl]- |
| Boc-DL-serine |
| N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-L-serine |
| L-Serine, N-[(1,1-dimethylethoxy)carbonyl]- |
| N-(tert-Butoxycarbonyl)-L-serine |