N-Boc-DL-serine methyl ester structure
|
Common Name | N-Boc-DL-serine methyl ester | ||
|---|---|---|---|---|
| CAS Number | 69942-12-7 | Molecular Weight | 219.235 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 354.3±32.0 °C at 760 mmHg | |
| Molecular Formula | C9H17NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.1±25.1 °C | |
Use of N-Boc-DL-serine methyl esterN-BOC-DL-serine methyl ester is a Serine derivative. N-BOC-DL-serine methyl ester is used for the synthesis of α,β-dehydro-α-amino acid. N-BOC-DL-serine methyl ester is also used for the synthesis of anti-cancer agent, such as quinazolinone derivative that inhibits PI3K activity, and tricyclic pyrolopyranopyridines that inhibits protein kinase activity[1][2][3]. |
| Name | Methyl 2-((tert-butoxycarbonyl)amino)-3-hydroxypropanoate |
|---|---|
| Synonym | More Synonyms |
| Description | N-BOC-DL-serine methyl ester is a Serine derivative. N-BOC-DL-serine methyl ester is used for the synthesis of α,β-dehydro-α-amino acid. N-BOC-DL-serine methyl ester is also used for the synthesis of anti-cancer agent, such as quinazolinone derivative that inhibits PI3K activity, and tricyclic pyrolopyranopyridines that inhibits protein kinase activity[1][2][3]. |
|---|---|
| Related Catalog | |
| References |
[1]. Yang Yongqing, et al. Method for synthesizing α,β-dehydro-α-amino acid. Patent CN105037210. |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 354.3±32.0 °C at 760 mmHg |
| Molecular Formula | C9H17NO5 |
| Molecular Weight | 219.235 |
| Flash Point | 168.1±25.1 °C |
| Exact Mass | 219.110672 |
| PSA | 88.35000 |
| LogP | 0.80 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.461 |
| InChIKey | SANNKFASHWONFD-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CO)NC(=O)OC(C)(C)C |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| Serine, N-[(1,1-dimethylethoxy)carbonyl]-, methyl ester |
| Methyl N-(tert-butoxycarbonyl)serinate |
| Methyl N-{[(2-methyl-2-propanyl)oxy]carbonyl}serinate |
| methyl 3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| N-Boc-DL-serine methyl ester |