Glyphosate isopropylamine salt structure
|
Common Name | Glyphosate isopropylamine salt | ||
|---|---|---|---|---|
| CAS Number | 38641-94-0 | Molecular Weight | 346.40400 | |
| Density | 1.218 g/mL at 25ºC | Boiling Point | 465.8ºC at 760 mmHg | |
| Molecular Formula | C12H35N4O5P | Melting Point | 200ºC | |
| MSDS | N/A | Flash Point | 235.5ºC | |
| Symbol |
GHS09 |
Signal Word | ||
| Name | glyphosate-isopropylammonium |
|---|---|
| Synonym | More Synonyms |
| Density | 1.218 g/mL at 25ºC |
|---|---|
| Boiling Point | 465.8ºC at 760 mmHg |
| Melting Point | 200ºC |
| Molecular Formula | C12H35N4O5P |
| Molecular Weight | 346.40400 |
| Flash Point | 235.5ºC |
| Exact Mass | 346.23500 |
| PSA | 208.08000 |
| Index of Refraction | n20/D 1.435 |
| InChIKey | ZEKANFGSDXODPD-UHFFFAOYSA-N |
| SMILES | CC(C)N.O=C(O)CNCP(=O)(O)O |
| Stability | Stable. Incompatible with strong oxidizing agents. |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS09 |
|---|---|
| Hazard Statements | H411 |
| Precautionary Statements | P273 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36 |
| Safety Phrases | 26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | - |
| HS Code | 2931900090 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
|
In situ fluorimetric determination of pesticides on vegetables. Hassoon S and Schechter I.
Anal. Chim. Acta 405(1) , 9-15, (2000)
|
|
|
Lee H-L and Guo H-R.
Herbicides, Theory and Applications , 978-53, (2011)
|
|
|
Fate and Mobility of Glyphosate Leachate in Palestinian Soil Using Soil Column. Jodeh S, et al.
J. Mater. Environ. Sci. 5(6) , 2008-16, (2014)
|
| Utal |
| Fosulen |
| Roundup |
| Rodeo |
| glyphosate isopropylamine |
| 2-(phosphonomethylamino)acetic acid,propan-2-amine |
| Nitosorg |
| isopropylammonium N-(phosphonomethyl)glycinate |
| Spectra |
| Roundup,Glysate,Glifocas,Glyfosate |
| MFCD00075118 |
| N-(phosphonomethyl)glycine - isopropylamine (1:1) |
| Roundup,Glysate,Glifocas |
| N-(phosphonomethyl)glycine mono-isopropylammonium salt |
| Landmaster |
| Rattler |
| isopropyl glyphosate |
| N-(phosphomethyl)glycine isopropylammonium salt |
| isopropylamine glyphosate salt |
| N-(phosphonomethyl) glycine isopropylamine salt |
| N-(phosphonomethyl)glycine compound with 2-propanamine (1:1) |
| Buggy |
| Glyphosate-isopropylammonium |
| isopropylamine salt of glyphosate |
| Glyphosate isopropylamine salt |
| EINECS 254-056-8 |