Triptonide structure
|
Common Name | Triptonide | ||
|---|---|---|---|---|
| CAS Number | 38647-11-9 | Molecular Weight | 358.385 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 581.1±50.0 °C at 760 mmHg | |
| Molecular Formula | C20H22O6 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 257.8±30.2 °C | |
| Symbol |
GHS06, GHS08 |
Signal Word | Danger | |
Use of TriptonideTriptonide(NSC 165677; PG 492), extracted from Tripterygium wilfordii Hook, inhibited the proliferation of mouse splenocytes induced by suboptimal concentration of concanavalin A or lipopolysaccharide at concentrations of 0.02, 0.1, and 0.5 mg/ml. |
| Name | Triptonide |
|---|---|
| Synonym | More Synonyms |
| Description | Triptonide(NSC 165677; PG 492), extracted from Tripterygium wilfordii Hook, inhibited the proliferation of mouse splenocytes induced by suboptimal concentration of concanavalin A or lipopolysaccharide at concentrations of 0.02, 0.1, and 0.5 mg/ml. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 581.1±50.0 °C at 760 mmHg |
| Molecular Formula | C20H22O6 |
| Molecular Weight | 358.385 |
| Flash Point | 257.8±30.2 °C |
| Exact Mass | 358.141632 |
| PSA | 80.96000 |
| LogP | 1.49 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.638 |
| InChIKey | SWOVVKGLGOOUKI-ZHGGVEMFSA-N |
| SMILES | CC(C)C12OC1C1OC13C1(C)CCC4=C(COC4=O)C1CC1OC13C2=O |
| Storage condition | 2-8°C |
| Symbol |
GHS06, GHS08 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H300 + H330-H361f |
| Precautionary Statements | P201-P260-P284-P301 + P310 + P330-P304 + P340 + P310-P403 + P233 |
| Hazard Codes | T+ |
| RIDADR | 2811.0 |
| Hazard Class | 6.1 |
| l-triptonide |
| Triptolide,14-deoxy-14-oxo |
| Triptonide |
| (3bS,4aS,5aS,6aS,7aS,7bS,8aS,8bS)-6a-Isopropyl-8b-methyl-3b,4,4a,7a,7b,8b,9,10-octahydrotrisoxireno[6,7:8a,9:4b,5]phenanthro[1,2-c]furan-1,6(3H,6aH)-dione |
| Trisoxireno[6,7:8a,9:4b,5]phenanthro[1,2-c]furan-1,6(3H,6aH)-dione, 3b,4,4a,7a,7b,8b,9,10-octahydro-8b-methyl-6a-(1-methylethyl)-, (3bS,4aS,5aS,6aS,7aS,7bS,8aS,8bS)- |
| 14-Deoxy-14-oxotriptolide |
| (3bS,4aS,5aS,6aS,7aS,7bS,8aS,8bS)-8b-methyl-6a-(propan-2-yl)-3b,4,4a,7a,7b,8b,9,10-octahydrotrisoxireno[6,7:8a,9:4b,5]phenanthro[1,2-c]furan-1,6(3H,6aH)-dione |