4-Chloro-3-nitrobenzoyl chloride structure
|
Common Name | 4-Chloro-3-nitrobenzoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 38818-50-7 | Molecular Weight | 220.010 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 301.7±22.0 °C at 760 mmHg | |
| Molecular Formula | C7H3Cl2NO3 | Melting Point | 47-54 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 136.3±22.3 °C | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 4-Chloro-3-nitrobenzoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 301.7±22.0 °C at 760 mmHg |
| Melting Point | 47-54 °C(lit.) |
| Molecular Formula | C7H3Cl2NO3 |
| Molecular Weight | 220.010 |
| Flash Point | 136.3±22.3 °C |
| Exact Mass | 218.949005 |
| PSA | 62.89000 |
| LogP | 2.68 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.603 |
| InChIKey | IWLGXPWQZDOMSB-UHFFFAOYSA-N |
| SMILES | O=C(Cl)c1ccc(Cl)c([N+](=O)[O-])c1 |
| Storage condition | Refrigerator |
| Stability | Stable, but may be air and moisture sensitive. Incompatible with strong oxidizing agents. |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C:Corrosive; |
| Risk Phrases | R21;R34 |
| Safety Phrases | S26-S27-S36/37/39-S45-S25 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 8 |
| HS Code | 2916399090 |
|
~89%
4-Chloro-3-nitr... CAS#:38818-50-7 |
| Literature: Berrada, Amal; Cavelier, Florine; Jacquier, Robert; Verducci, Jean Bulletin de la Societe Chimique de France, 1989 , # 4 p. 511 - 514 |
|
~%
4-Chloro-3-nitr... CAS#:38818-50-7 |
| Literature: Eli Lilly and Company Patent: US4008243 A1, 1977 ; |
|
~%
4-Chloro-3-nitr... CAS#:38818-50-7 |
| Literature: Zeneca Limited Patent: US5451594 A1, 1995 ; |
|
~%
4-Chloro-3-nitr... CAS#:38818-50-7 |
| Literature: Spiniello, Marisa; White, Jonathan M. Organic and Biomolecular Chemistry, 2003 , vol. 1, # 17 p. 3094 - 3101 |
|
~%
4-Chloro-3-nitr... CAS#:38818-50-7 |
| Literature: Spiniello, Marisa; White, Jonathan M. Organic and Biomolecular Chemistry, 2003 , vol. 1, # 17 p. 3094 - 3101 |
|
~%
4-Chloro-3-nitr... CAS#:38818-50-7 |
| Literature: Montagne Recueil des Travaux Chimiques des Pays-Bas, 1900 , vol. 19, p. 55 |
| Precursor 5 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Synthesis and antioxidant potential of novel synthetic benzophenone analogues.
Eur. J. Med. Chem. 44(6) , 2724-30, (2009) Considering that oxidative stress is strongly implicated in the toxicity of chemotherapy, much effort is focused on the research of diverse antioxidants as protective agents. An efficient synthesis of... |
|
|
Insights into the N,N-diacylation reaction of 2-aminopyrimidines and deactivated anilines: an alternative N-monoacylation reaction. Theodorou V, et al.
ARKIVOC 4 , 11-23, (2014)
|
| 3-Nitro-4-chlorobenzoic acid chloride |
| 2-chloro-3-nitrobenzoyl chloride |
| 4-Chloro-3-nitrobenzoyl chloride |
| EINECS 254-133-6 |
| 4-chloro-3-nitro-benzoyl chloride |
| Benzoyl chloride,4-chloro-3-nitro |
| 3-NITRO-4-CHLOROBENZOYLCHLORIDE |
| 4-chloro-3-nitro-benzoic acid chloride |
| 3-nitro-4-chlorobenzenecarboxylic acid chloride |
| Benzoyl chloride, 4-chloro-3-nitro- |
| MFCD00035743 |