4-Chloro-3-nitrobenzoic acid structure
|
Common Name | 4-Chloro-3-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 96-99-1 | Molecular Weight | 201.564 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 371.6±27.0 °C at 760 mmHg | |
| Molecular Formula | C7H4ClNO4 | Melting Point | 180-183 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 178.5±23.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-Chloro-3-nitrobenzoic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 371.6±27.0 °C at 760 mmHg |
| Melting Point | 180-183 °C(lit.) |
| Molecular Formula | C7H4ClNO4 |
| Molecular Weight | 201.564 |
| Flash Point | 178.5±23.7 °C |
| Exact Mass | 200.982880 |
| PSA | 83.12000 |
| LogP | 2.37 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.628 |
| InChIKey | DFXQXFGFOLXAPO-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(Cl)c([N+](=O)[O-])c1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 2 |
| RTECS | DG5425050 |
| HS Code | 2918990090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Elastic and bendable caffeine cocrystals: implications for the design of flexible organic materials.
Angew. Chem. Int. Ed. Engl. 51(41) , 10319-23, (2012)
|
|
|
[Evaluation of the hepatotoxic activity of several chlor-nitro derivatives of benzoic acid].
Vopr. Med. Khim. 29(6) , 113-7, (1983) Hepatotoxic effects of 4-chloro-3-nitrobenzoic acid (x-NBA), 3-nitrobenzoic acid (NBA) and 4-chlorobenzoic acid (CBA) were studied at the doses corresponding to LD50, 1/10 LD50 and 1/50 LD50. The toxi... |
|
|
Preparation and antibacterial activity of copper and cobalt complexes of 4-chloro-3-nitrobenzoate with a nitrogen donor ligand.
Chem. Pharm. Bull. 55(3) , 446-50, (2007) Copper and cobalt complexes with 4-chloro-3-nitrobenzoate (ClNBz) and the nitrogen ligands 1,3-diaminopropane (1,3-DAP) or o-phenylenediamine (o-PDA), were prepared and characterized. The complexes [C... |
| 4-Chloro-3-nitrobenzoic acid |
| MFCD00007079 |
| Benzoic acid, 4-chloro-3-nitro- |
| EINECS 202-550-9 |
| 3-Nitro-4-chlorobenzoic acid |