Ophiopogonin B structure
|
Common Name | Ophiopogonin B | ||
|---|---|---|---|---|
| CAS Number | 38971-41-4 | Molecular Weight | 722.902 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 835.7±65.0 °C at 760 mmHg | |
| Molecular Formula | C39H62O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 459.2±34.3 °C | |
Use of Ophiopogonin BOphiopogonin B induces the autophagy and apoptosis of colon cancer cells by activating JNK/c-Jun signaling pathway. Ophiopogonin B is a saponin compound isolated from Radix Ophiopogonjaponicus[1]. |
| Name | ophiopogonin B |
|---|---|
| Synonym | More Synonyms |
| Description | Ophiopogonin B induces the autophagy and apoptosis of colon cancer cells by activating JNK/c-Jun signaling pathway. Ophiopogonin B is a saponin compound isolated from Radix Ophiopogonjaponicus[1]. |
|---|---|
| Related Catalog | |
| Target |
JNK |
| In Vitro | Ophiopogonin B (0, 5, 10and 20 μM) suppresses the proliferation of HT-29 and HCT-116 cell lines through the G0/G1 phase cell cycle arrest[1]. Ophiopogonin B induces apoptosis by inhibiting the expression of Bax and cleaved caspase 3 and promoting the expression of Bcl-2. Treatment with Ophiopogonin B also increases the expression of Beclin 1 and the conversion of LC3I to LC3II with the activation of JNK/c-Jun signaling pathway[1]. |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 835.7±65.0 °C at 760 mmHg |
| Molecular Formula | C39H62O12 |
| Molecular Weight | 722.902 |
| Flash Point | 459.2±34.3 °C |
| Exact Mass | 722.424133 |
| PSA | 176.76000 |
| LogP | 5.63 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.604 |
| InChIKey | OWGURJWJHWYCIQ-AKYREZHBSA-N |
| SMILES | CC1CCC2(OC1)OC1CC3C4CC=C5CC(O)CC(OC6OC(C)C(O)C(O)C6OC6OC(C)C(O)C(O)C6O)C5(C)C4CCC3(C)C1C2C |
| Hazard Codes | Xi |
|---|
|
~%
Ophiopogonin B CAS#:38971-41-4 |
| Literature: Watanabe, Yoshiaki; Sanada, Shuichi; Ida, Yoshiteru; Shoji, Junzo Chemical & Pharmaceutical Bulletin, 1984 , vol. 32, # 10 p. 3994 - 4002 |
|
~%
Ophiopogonin B CAS#:38971-41-4 |
| Literature: Watanabe, Yoshiaki; Sanada, Shuichi; Ida, Yoshiteru; Shoji, Junzo Chemical & Pharmaceutical Bulletin, 1984 , vol. 32, # 10 p. 3994 - 4002 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| α-D-Galactopyranoside, (1β,3β,25R)-3-hydroxyspirost-5-en-1-yl 6-deoxy-2-O-(6-deoxy-α-L-mannopyranosyl)- |
| 4-Octacosanone,24-hydroxy |
| 24-hydroxy-4-octacosanone |
| (1β,3β,25R)-3-Hydroxyspirost-5-en-1-yl 6-deoxy-2-O-(6-deoxy-α-L-mannopyranosyl)-α-D-galactopyranoside |