Ruscogenin structure
|
Common Name | Ruscogenin | ||
|---|---|---|---|---|
| CAS Number | 472-11-7 | Molecular Weight | 430.62 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 563.1±50.0 °C at 760 mmHg | |
| Molecular Formula | C27H42O4 | Melting Point | 198-202ºC | |
| MSDS | Chinese USA | Flash Point | 294.4±30.1 °C | |
Use of RuscogeninRuscogenin, an important steroid sapogenin derived from Ophiopogon japonicus, attenuates cerebral ischemia-induced blood-brain barrier dysfunction by suppressing TXNIP/NLRP3 inflammasome activation and the MAPK pathway and exerts significant anti-inflammatory and anti-thrombotic activities[1][2]. |
| Name | Ruscogenin |
|---|---|
| Synonym | More Synonyms |
| Description | Ruscogenin, an important steroid sapogenin derived from Ophiopogon japonicus, attenuates cerebral ischemia-induced blood-brain barrier dysfunction by suppressing TXNIP/NLRP3 inflammasome activation and the MAPK pathway and exerts significant anti-inflammatory and anti-thrombotic activities[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 563.1±50.0 °C at 760 mmHg |
| Melting Point | 198-202ºC |
| Molecular Formula | C27H42O4 |
| Molecular Weight | 430.62 |
| Flash Point | 294.4±30.1 °C |
| Exact Mass | 430.308319 |
| PSA | 58.92000 |
| LogP | 4.29 |
| Vapour Pressure | 0.0±3.5 mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | QMQIQBOGXYYATH-IDABPMKMSA-N |
| SMILES | CC1CCC2(OC1)OC1CC3C4CC=C5CC(O)CC(O)C5(C)C4CCC3(C)C1C2C |
| Storage condition | 2~8℃ |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| (1β,3β,25R)-Spirost-5-ene-1,3-diol |
| 25D-Spirost-5-ene-1|A,3|A-diol |
| (25R)-Spirost-5-ene-1b,3b-diol |
| (25R)-Spirost-5-ene-1β,3β-diol |
| (1β,3β,25R)-Spirost-5-en-1,3-diol |
| Spirost-5-en-1,3-diol, (1β,3β,25R)- |