Picroside II structure
|
Common Name | Picroside II | ||
|---|---|---|---|---|
| CAS Number | 39012-20-9 | Molecular Weight | 512.461 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 780.8±60.0 °C at 760 mmHg | |
| Molecular Formula | C23H28O13 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 267.9±26.4 °C | |
Use of Picroside IIPicroside II, an iridoid compound extracted from Picrorhiza, exhibits anti-inflammatory and anti-apoptotic activities. picroside II alleviates the inflammatory response in sepsis and enhances immune function by inhibiting the activation of NLRP3 inflammasome and NF-κB pathways[1]. Picroside II is an antioxidant, exhibits a significant neuroprotective effect through reducing ROS production and protects the blood-brain barrier (BBB) after cerebral ischemia-reperfusion (CI/R) injury[2]. |
| Name | Picroside II |
|---|---|
| Synonym | More Synonyms |
| Description | Picroside II, an iridoid compound extracted from Picrorhiza, exhibits anti-inflammatory and anti-apoptotic activities. picroside II alleviates the inflammatory response in sepsis and enhances immune function by inhibiting the activation of NLRP3 inflammasome and NF-κB pathways[1]. Picroside II is an antioxidant, exhibits a significant neuroprotective effect through reducing ROS production and protects the blood-brain barrier (BBB) after cerebral ischemia-reperfusion (CI/R) injury[2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 780.8±60.0 °C at 760 mmHg |
| Molecular Formula | C23H28O13 |
| Molecular Weight | 512.461 |
| Flash Point | 267.9±26.4 °C |
| Exact Mass | 512.153015 |
| PSA | 197.13000 |
| LogP | -2.50 |
| Vapour Pressure | 0.0±2.8 mmHg at 25°C |
| Index of Refraction | 1.681 |
| InChIKey | AKNILCMFRRDTEY-MRFBWRKESA-N |
| SMILES | COc1cc(C(=O)OC2C3C=COC(OC4OC(CO)C(O)C(O)C4O)C3C3(CO)OC23)ccc1O |
| Storage condition | 2-8°C |
| Water Solubility | ethanol: soluble1mg/mL, clear, colorless |
| AMPHICOSIDE |
| Amphicoside II |
| PicrosideII |
| Vanilloyl catalpol |
| Picroside-2 |
| 6'-VANILLOYL CATALPOL |
| 2-(Hexopyranosyloxy)-1a-(hydroxymethyl)-1a,1b,2,5a,6,6a-hexahydrooxireno[4,5]cyclopenta[1,2-c]pyran-6-yl 4-hydroxy-3-methoxybenzoate |
| PICROSID II |
| Benzoic acid, 4-hydroxy-3-methoxy-, 2-(hexopyranosyloxy)-1a,1b,2,5a,6,6a-hexahydro-1a-(hydroxymethyl)oxireno[4,5]cyclopenta[1,2-c]pyran-6-yl ester |