3-Quinolinecarboxylicacid, 4-hydroxy-7-(trifluoromethyl)-, ethyl ester structure
|
Common Name | 3-Quinolinecarboxylicacid, 4-hydroxy-7-(trifluoromethyl)-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 391-02-6 | Molecular Weight | 285.21900 | |
| Density | 1.373g/cm3 | Boiling Point | 348.9ºC at 760mmHg | |
| Molecular Formula | C13H10F3NO3 | Melting Point | >300ºC(lit.) | |
| MSDS | Chinese | Flash Point | 164.8ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | ethyl 4-hydroxy-7-(trifluoromethyl)quinoline-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.373g/cm3 |
|---|---|
| Boiling Point | 348.9ºC at 760mmHg |
| Melting Point | >300ºC(lit.) |
| Molecular Formula | C13H10F3NO3 |
| Molecular Weight | 285.21900 |
| Flash Point | 164.8ºC |
| Exact Mass | 285.06100 |
| PSA | 59.42000 |
| LogP | 3.13590 |
| Index of Refraction | 1.509 |
| InChIKey | YHUWNMJUAZJACG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c[nH]c2cc(C(F)(F)F)ccc2c1=O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933499090 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Photophysical properties of novel rare earth complexes with ethyl 4 hydroxy 7 trifluoromethyl 3 quinolinecarboxylate. Honjie, et al.
Chin. J. Inorg. Chem. 4 , (1998)
|
| 4-Hydroxy-7-trifluormethyl-chinolin-3-carbonsaeure-aethylester |
| 4-hydroxy-7-trifluoromethyl-quinoline-3-carboxylic acid ethyl ester |
| ethyl 7-(trifluoromethyl)-4-hydroxyquinoline-3-carboxylate |
| ethyl 4-hydroxy-7-trifluoromethylquinoline-3-carboxylate |
| EINECS 206-871-5 |
| 7-trifluoromethyl-4-hydroxyquinoline-3-carboxylic acid ethyl ester |
| ETHYL 4-HYDROXY-7-TRIFLUOROMETHYL-3-QUINOLINECARBOXYLATE |
| ethyl 4-hydroxy-7-trifluoromethyl-3-quinolinecarb |
| 4-keto-7-(trifluoromethyl)-1H-quinoline-3-carboxylic acid ethyl ester |
| ethyl 4-oxo-7-(trifluoromethyl)-1H-quinoline-3-carboxylate |
| MFCD00006769 |
| BUTTPARK 219-47 |
| 4-Hydroxy-7-(trifluoromethyl)-3-quinolinecarboxylic acid ethyl ester |