Rapamycin-d3 structure
|
Common Name | Rapamycin-d3 | ||
|---|---|---|---|---|
| CAS Number | 392711-19-2 | Molecular Weight | 917.19000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C51H76D3NO13 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Rapamycin-d3Rapamycin-d3 (Sirolimus-d3) is the deuterium labeled Rapamycin. Rapamycin is a potent and specific mTOR inhibitor with an IC50of 0.1 nM in HEK293 cells. Rapamycin binds to FKBP12 and specifically acts as an allosteric inhibitor of mTORC1[1]. Rapamycin is an autophagy activator, an immunosuppressant[2]. |
| Name | Rapamycin-d3 |
|---|---|
| Synonym | More Synonyms |
| Description | Rapamycin-d3 (Sirolimus-d3) is the deuterium labeled Rapamycin. Rapamycin is a potent and specific mTOR inhibitor with an IC50of 0.1 nM in HEK293 cells. Rapamycin binds to FKBP12 and specifically acts as an allosteric inhibitor of mTORC1[1]. Rapamycin is an autophagy activator, an immunosuppressant[2]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C51H76D3NO13 |
|---|---|
| Molecular Weight | 917.19000 |
| Exact Mass | 916.57400 |
| PSA | 195.43000 |
| LogP | 6.11850 |
| InChIKey | QFJCIRLUMZQUOT-NWORAYHKSA-N |
| SMILES | COC1CC2CCC(C)C(O)(O2)C(=O)C(=O)N2CCCCC2C(=O)OC(C(C)CC2CCC(O)C(OC)C2)CC(=O)C(C)C=C(C)C(O)C(OC)C(=O)C(C)CC(C)C=CC=CC=C1C |
| Hazard Codes | Xi |
|---|
| [2H3]-Sirolimus |
| Rapamycin,7-O-demethyl-7-O-(methyl-d3) |