10-iminophenanthren-9-one structure
|
Common Name | 10-iminophenanthren-9-one | ||
|---|---|---|---|---|
| CAS Number | 3942-85-6 | Molecular Weight | 207.22700 | |
| Density | 1.24g/cm3 | Boiling Point | 395.8ºC at 760 mmHg | |
| Molecular Formula | C14H9NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.2ºC | |
| Name | 10-iminophenanthren-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 395.8ºC at 760 mmHg |
| Molecular Formula | C14H9NO |
| Molecular Weight | 207.22700 |
| Flash Point | 193.2ºC |
| Exact Mass | 207.06800 |
| PSA | 40.92000 |
| LogP | 3.01750 |
| Index of Refraction | 1.669 |
| InChIKey | KTOHWYNGCILGLH-UHFFFAOYSA-N |
| SMILES | N=C1C(=O)c2ccccc2-c2ccccc21 |
| HS Code | 2925290090 |
|---|
|
~%
10-iminophenant... CAS#:3942-85-6 |
| Literature: Stein; Day Journal of the American Chemical Society, 1942 , vol. 64, p. 2569,2572 |
|
~%
10-iminophenant... CAS#:3942-85-6 |
| Literature: Anschuetz; Schultz Justus Liebigs Annalen der Chemie, 1879 , vol. 196, p. 48 |
|
~%
10-iminophenant... CAS#:3942-85-6 |
| Literature: Anschuetz; Schultz Justus Liebigs Annalen der Chemie, 1879 , vol. 196, p. 48 Full Text Show Details Zincke Chemische Berichte, 1879 , vol. 12, p. 1646 |
| Precursor 4 | |
|---|---|
| DownStream 8 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 10-Imino-10H-phenanthren-9-on |
| 9,10-phenanthrenequinonemonoimide |
| 10-imino-10H-phenanthren-9-one |
| 9,10-Phenanthrenequinone-monoimine |
| 9,10-phenanthrenequinone momoimine |
| (10z)-10-iminophenanthren-9(10h)-one |