Diethyl 5-hydroxyisophthalate structure
|
Common Name | Diethyl 5-hydroxyisophthalate | ||
|---|---|---|---|---|
| CAS Number | 39630-68-7 | Molecular Weight | 238.237 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 382.7±22.0 °C at 760 mmHg | |
| Molecular Formula | C12H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 145.3±15.8 °C | |
| Name | diethyl 5-hydroxybenzene-1,3-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 382.7±22.0 °C at 760 mmHg |
| Molecular Formula | C12H14O5 |
| Molecular Weight | 238.237 |
| Flash Point | 145.3±15.8 °C |
| Exact Mass | 238.084122 |
| PSA | 72.83000 |
| LogP | 3.64 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.532 |
| InChIKey | PUZBTHGPBGQFLW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(O)cc(C(=O)OCC)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918199090 |
|
~10%
Diethyl 5-hydro... CAS#:39630-68-7 |
| Literature: Zhang, San-Qi; Fukase, Koichi; Izumi, Minoru; Fukase, Yoshiyuki; Kusumoto, Shoichi Synlett, 2001 , # 5 p. 590 - 596 |
|
~%
Diethyl 5-hydro... CAS#:39630-68-7 |
| Literature: Cunliffe, Denise; Leason, Mark; Parkin, Donald; Lea, Peter J. Phytochemistry (Elsevier), 1983 , vol. 22, # 6 p. 1357 - 1360 |
| Precursor 3 | |
|---|---|
| DownStream 7 | |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| diethyl ester of 5-hydroxyisophthalic acid |
| methyl,methyl 5-hydroxyisophthalate |
| diethyl 5-hydroxylsophthalate |
| Diethyl 5-hydroxyisophthalate |
| ethyl 5-(ethoxycarbonyl)-3-hydroxybenzoate |
| 1,3-Benzenedicarboxylic acid, 5-hydroxy-, diethyl ester |
| 5-Hydroxy-isophthalic acid diethyl ester |