5-Hydroxyisophthalic acid structure
|
Common Name | 5-Hydroxyisophthalic acid | ||
|---|---|---|---|---|
| CAS Number | 618-83-7 | Molecular Weight | 182.130 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 516.9±45.0 °C at 760 mmHg | |
| Molecular Formula | C8H6O5 | Melting Point | 298-302 °C(lit.) | |
| MSDS | USA | Flash Point | 280.5±25.2 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 5-Hydroxyisophthalic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 516.9±45.0 °C at 760 mmHg |
| Melting Point | 298-302 °C(lit.) |
| Molecular Formula | C8H6O5 |
| Molecular Weight | 182.130 |
| Flash Point | 280.5±25.2 °C |
| Exact Mass | 182.021530 |
| PSA | 94.83000 |
| LogP | 1.60 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.666 |
| InChIKey | QNVNLUSHGRBCLO-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(O)cc(C(=O)O)c1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 2 |
| RTECS | CZ4280000 |
| HS Code | 29182990 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
|
Application of stripping voltammetry to trace lead analysis in intermediates and final products of syntheses of pharmaceuticals.
J. Pharm. Biomed. Anal. 14(7) , 765-71, (1996) Applications of differential pulse anodic stripping voltammetry using a new pen-type renewed hanging mercury electrode have been investigated for trace analysis of lead in pharmaceutical substances an... |
|
|
[Information from the Soviet Toxicology Center].
Gig. Tr. Prof. Zabol. (2) , 52-3, (1983)
|
|
|
Two 3D chiral coordination polymers with 4-connected 6(6) topological net: synthesis, structure and magnetic properties.
Dalton Trans. (44) , 9807-11, (2009) The hydrothermal reaction of Co(II)/Cu(II), 5-hydroxyisophthalic acid and dipyridophenazine leads to the generation of two 3D chiral coordination polymers, [M(hip)(DPPZ)](n) (M = Co(), Cu(), H(2)hip =... |
| 1,3-Benzenedicarboxylic acid, 5-hydroxy- |
| 5-hydroxybenzene-1,3-dicarboxylic acid |
| EINECS 210-565-7 |
| MFCD00002515 |
| 5-hydroxy-isophthalic acid |
| 5-Hydroxyisophthalic acid |