H-Arg-pNA·2HCl structure
|
Common Name | H-Arg-pNA·2HCl | ||
|---|---|---|---|---|
| CAS Number | 40127-11-5 | Molecular Weight | 367.232 | |
| Density | N/A | Boiling Point | 621.6ºC at 760 mmHg | |
| Molecular Formula | C12H20Cl2N6O3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 329.8ºC | |
| Name | L-Arginine p-nitroanilide dihydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 621.6ºC at 760 mmHg |
|---|---|
| Molecular Formula | C12H20Cl2N6O3 |
| Molecular Weight | 367.232 |
| Flash Point | 329.8ºC |
| Exact Mass | 366.097382 |
| PSA | 162.84000 |
| LogP | 4.21530 |
| InChIKey | FBVMDLFQVOFFHS-XRIOVQLTSA-N |
| SMILES | Cl.Cl.NC(N)=NCCCC(N)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| Storage condition | 2-8°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | C |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2925290090 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| MFCD00058249 |
| (S)-2-Amino-5-guanidino-N-(4-nitrophenyl)pentanamide dihydrochloride |
| Pentanamide, 2-amino-5-[(aminoiminomethyl)amino]-N-(4-nitrophenyl)-, (2S)-, hydrochloride (1:2) |
| N-(4-Nitrophenyl)argininamide dihydrochloride |
| (2S)-2-amino-5-(diaminomethylideneamino)-N-(4-nitrophenyl)pentanamide,dihydrochloride |
| H-Arg-pNA·2HCl |
| H-Arg-PNA.2HCl |