3,5-Bis(trifluoromethyl)benzoyl chloride structure
|
Common Name | 3,5-Bis(trifluoromethyl)benzoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 785-56-8 | Molecular Weight | 276.563 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 194.3±40.0 °C at 760 mmHg | |
| Molecular Formula | C9H3ClF6O | Melting Point | 41760ºC | |
| MSDS | Chinese USA | Flash Point | 72.2±0.0 °C | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 3,5-Bis(trifluoromethyl)benzoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 194.3±40.0 °C at 760 mmHg |
| Melting Point | 41760ºC |
| Molecular Formula | C9H3ClF6O |
| Molecular Weight | 276.563 |
| Flash Point | 72.2±0.0 °C |
| Exact Mass | 275.977661 |
| PSA | 17.07000 |
| LogP | 4.60 |
| Vapour Pressure | 0.4±0.4 mmHg at 25°C |
| Index of Refraction | 1.422 |
| InChIKey | WAKMMQSMEDJRRI-UHFFFAOYSA-N |
| SMILES | O=C(Cl)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | C:Corrosive; |
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | II |
| Hazard Class | 8 |
| HS Code | 2942000000 |
|
~97%
3,5-Bis(trifluo... CAS#:785-56-8 |
| Literature: ZALICUS PHARMACEUTICALS LTD.; PAJOUHESH, Hassan, A.; HOLLAND, Richard; ZHANG, Lingyun; PAJOUHESH, Hossein, O.; LAMONTAGNE, Jason; WHELAN, Brendan; SHORT, Glenn, F., III.; ROMERO, Donna, L. Patent: WO2013/131018 A1, 2013 ; Location in patent: Page/Page column 56 ; |
|
~%
3,5-Bis(trifluo... CAS#:785-56-8 |
| Literature: US2001/14759 A1, ; |
|
~%
3,5-Bis(trifluo... CAS#:785-56-8 |
| Literature: US2009/227611 A1, ; Page/Page column 11 ; |
|
~%
3,5-Bis(trifluo... CAS#:785-56-8 |
| Literature: Bulletin de la Societe Chimique de France, , p. 587 - 593 |
|
~%
3,5-Bis(trifluo... CAS#:785-56-8 |
| Literature: Bulletin de la Societe Chimique de France, , p. 587 - 593 |
| Precursor 5 | |
|---|---|
| DownStream 9 | |
| HS Code | 2942000000 |
|---|
|
Quantitative measurement of clonidine in human plasma by combined gas chromatography/electron capture negative ion chemical ionization mass spectrometry.
Biomed. Environ. Mass Spectrom. 17(6) , 443-8, (1988) A new quantitative and selective assay was developed for the measurement of low levels of clonidine in human plasma. The drug and the deuterated internal standard (2H4)clonidine are quantified by gas ... |
| 3,5-Bis(trifluoromethyl)benzoyl chloride |
| EINECS 212-322-0 |
| 3,5-bis-trifluoromethyl-benzoic acid chloride |
| 3,5-Di(trifluoromethyl)benzoyl chloride |
| MFCD00000387 |
| FXFFR CVG EXFFF |
| 3,5-(bistrifluoromethyl)benzoyl chloride |
| 3,5-bis(trifluoromethyl)phenyl carboxylic acid chloride |
| 3,5-bis(CF3)PhCOCl |
| 3,5-bis(trifluoromethyl)benzoylchloride |