SB-399885 structure
|
Common Name | SB-399885 | ||
|---|---|---|---|---|
| CAS Number | 402713-80-8 | Molecular Weight | 446.34800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H21Cl2N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of SB-399885SB399885 is a potent, selective, brain penetrant and orally active 5-HT6 receptor antagonist with pKi values 9.11 and 9.02 for human recombinant and native 5-HT6 receptors, respectively. SB399885 has cognitive enhancing properties[1]. |
| Name | N-(3,5-dichloro-2-methoxyphenyl)-4-methoxy-3-piperazin-1-ylbenzenesulfonamide,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | SB399885 is a potent, selective, brain penetrant and orally active 5-HT6 receptor antagonist with pKi values 9.11 and 9.02 for human recombinant and native 5-HT6 receptors, respectively. SB399885 has cognitive enhancing properties[1]. |
|---|---|
| Related Catalog | |
| Target |
5-HT6 Receptor:9.02 (pKi) Human 5-HT6 Receptor:9.11 (pKi) |
| References |
| Molecular Formula | C18H21Cl2N3O4S |
|---|---|
| Molecular Weight | 446.34800 |
| Exact Mass | 445.06300 |
| PSA | 88.28000 |
| LogP | 4.76860 |
| InChIKey | ATKZKAYWARYLBW-UHFFFAOYSA-N |
| SMILES | COc1ccc(S(=O)(=O)Nc2cc(Cl)cc(Cl)c2OC)cc1N1CCNCC1 |
| N-(3,5-Dichloro-2-methoxyphenyl)-4-methoxy-3-(piperazin-1-yl)benzenesulfonamide |
| N-(3,5-Dichloro-2-methoxyphenyl)-4-methoxy-3-(1-piperazinyl)benzenesulfonamide |
| Benzenesulfonamide, N-(3,5-dichloro-2-methoxyphenyl)-4-methoxy-3-(1-piperazinyl)- |