2,4,6-Tri-tert-butylnitrobenzene structure
|
Common Name | 2,4,6-Tri-tert-butylnitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 4074-25-3 | Molecular Weight | 291.42800 | |
| Density | 0.967g/cm3 | Boiling Point | 326ºC at 760 mmHg | |
| Molecular Formula | C18H29NO2 | Melting Point | 205-206 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 108.7ºC | |
| Name | 2,4,6-Tri-tert-butylnitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 0.967g/cm3 |
|---|---|
| Boiling Point | 326ºC at 760 mmHg |
| Melting Point | 205-206 °C(lit.) |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.42800 |
| Flash Point | 108.7ºC |
| Exact Mass | 291.22000 |
| PSA | 45.82000 |
| LogP | 6.01050 |
| Index of Refraction | 1.495 |
| InChIKey | IMDZOFHRUMJNQR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c([N+](=O)[O-])c(C(C)(C)C)c1 |
| Safety Phrases | S24/25 |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2904209090 |
| Precursor 6 | |
|---|---|
| DownStream 6 | |
| HS Code | 2904209090 |
|---|---|
| Summary | 2904209090 derivatives containing only nitro or only nitroso groups。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
A solid-state nitrogen-15 NMR and ab initio study of nitrobenzenes.
J. Org. Chem. 68(11) , 4258-64, (2003) Insight into the unexpectedly small range of isotropic nitrogen chemical shifts in nitrobenzene derivatives is gained through measurements of the chemical shift (CS) tensor by solid-state NMR experime... |
| MFCD00008818 |
| 1,3,5-tritert-butyl-2-nitrobenzene |
| EINECS 223-789-5 |
| 1,3,5-Tri-tert-butyl-2-nitrobenzene |