H-Arg-Ala-OH acetate salt structure
|
Common Name | H-Arg-Ala-OH acetate salt | ||
|---|---|---|---|---|
| CAS Number | 40968-45-4 | Molecular Weight | 305.331 | |
| Density | 1.45±0.1 g/cm3(Predicted) | Boiling Point | N/A | |
| Molecular Formula | C11H23N5O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2S)-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.45±0.1 g/cm3(Predicted) |
|---|---|
| Molecular Formula | C11H23N5O5 |
| Molecular Weight | 305.331 |
| Exact Mass | 305.169922 |
| PSA | 191.62000 |
| LogP | 0.53930 |
| InChIKey | WVRUNFYJIHNFKD-WDSKDSINSA-N |
| SMILES | CC(NC(=O)C(N)CCCN=C(N)N)C(=O)O |
| Storage condition | 2-8°C |
| Risk Phrases | 66-67 |
|---|---|
| HS Code | 2925290090 |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Name: Inhibition of UBR protein in rabbit reticulocyte lysates assessed as inhibition of Ar...
Source: ChEMBL
Target: N/A
External Id: CHEMBL2344562
|
|
Name: Inhibition of UBR protein in rabbit reticulocyte lysates assessed as inhibition of Ar...
Source: ChEMBL
Target: N/A
External Id: CHEMBL2344567
|
|
Name: Inhibition of UBR protein in rabbit reticulocyte lysates assessed as inhibition of RG...
Source: ChEMBL
Target: N/A
External Id: CHEMBL2344566
|
|
Name: Biological activity was measured against Angiotensin I converting enzyme
Source: ChEMBL
Target: Angiotensin-converting enzyme
External Id: CHEMBL858254
|
| L-Alanine,L-arginyl |
| N-L-arginyl-L-alanine |
| Arginylalanine |
| UNII-6KRO2N7539 |
| N-L-Arginyl-L-alanin |
| L-Arginyl-L-alanin |
| L-Alanine, L-arginyl-, acetate (1:1) |
| L-Arg-L-Ala |
| L-arginyl-L-alanine |
| L-Arginyl-L-alanine acetate (1:1) |
| H-Arg-Ala-OH |
| Acetyl Dipeptide-3 Aminohexanoate |
| Dipeptide-3 |