Benzeneacetamide,N-hydroxy-a-phenyl structure
|
Common Name | Benzeneacetamide,N-hydroxy-a-phenyl | ||
|---|---|---|---|---|
| CAS Number | 4099-51-8 | Molecular Weight | 227.25900 | |
| Density | 1.199g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H13NO2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
| Name | N-hydroxy-2,2-diphenylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.199g/cm3 |
|---|---|
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.25900 |
| Exact Mass | 227.09500 |
| PSA | 49.33000 |
| LogP | 2.71480 |
| Index of Refraction | 1.605 |
| InChIKey | OFSBBVCLWMCGNY-UHFFFAOYSA-N |
| SMILES | O=C(NO)C(c1ccccc1)c1ccccc1 |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H400 |
| Precautionary Statements | P273 |
| RIDADR | UN 3077 9 / PGIII |
| HS Code | 2924299090 |
| Precursor 9 | |
|---|---|
| DownStream 1 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Promiscuous actions of small molecule inhibitors of the protein kinase D-class IIa HDAC axis in striated muscle.
FEBS Lett. 589(10) , 1080-8, (2015) PKD-mediated phosphorylation of class IIa HDACs frees the MEF2 transcription factor to activate genes that govern muscle differentiation and growth. Studies of the regulation and function of this sign... |
| benzeneacetamide,n-hydroxy-|A-phenyl |
| 2,2-Diphenyl-acetohydroxamsaeure |
| 2,2-diphenyl-acetohydroxamic acid |
| Diphenylacetohydroxamic acid |
| N-Hydroxy diphenylacetamide |
| diphenyl acetic hydroxamic acid |