methyl diphenylacetate structure
|
Common Name | methyl diphenylacetate | ||
|---|---|---|---|---|
| CAS Number | 3469-00-9 | Molecular Weight | 226.27000 | |
| Density | 1.097g/cm3 | Boiling Point | 321.4ºC at 760mmHg | |
| Molecular Formula | C15H14O2 | Melting Point | 59-62 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 131.1ºC | |
| Name | methyl 2,2-diphenylacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.097g/cm3 |
|---|---|
| Boiling Point | 321.4ºC at 760mmHg |
| Melting Point | 59-62 °C(lit.) |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.27000 |
| Flash Point | 131.1ºC |
| Exact Mass | 226.09900 |
| PSA | 26.30000 |
| LogP | 2.99150 |
| Index of Refraction | 1.559 |
| InChIKey | AORIUCNKPVHMTN-UHFFFAOYSA-N |
| SMILES | COC(=O)C(c1ccccc1)c1ccccc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2916399090 |
| Precursor 10 | |
|---|---|
| DownStream 9 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| MFCD00025869 |
| Methyl diphenylacetate |
| Diphenylacetic acid,methyl ester |
| 2,2-Diphenylacetic acid methyl ester |
| methyl 2,2-diphenyl acetate |
| Acetic acid,diphenyl-,methyl ester |
| Diphenylacetic Acid Methyl Ester |
| diphenylacetate de methyle |
| methyl 1,1-diphenylacetate |
| EINECS 222-431-5 |