1,3-bis(4-acetylphenyl)thiourea structure
|
Common Name | 1,3-bis(4-acetylphenyl)thiourea | ||
|---|---|---|---|---|
| CAS Number | 42084-03-7 | Molecular Weight | 312.38600 | |
| Density | 1.297g/cm3 | Boiling Point | 489.2ºC at 760 mmHg | |
| Molecular Formula | C17H16N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.7ºC | |
| Name | 1,3-bis(4-acetylphenyl)thiourea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.297g/cm3 |
|---|---|
| Boiling Point | 489.2ºC at 760 mmHg |
| Molecular Formula | C17H16N2O2S |
| Molecular Weight | 312.38600 |
| Flash Point | 249.7ºC |
| Exact Mass | 312.09300 |
| PSA | 90.29000 |
| LogP | 4.04670 |
| Index of Refraction | 1.693 |
| InChIKey | WSNPLHQUYQOJFP-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(NC(=S)Nc2ccc(C(C)=O)cc2)cc1 |
|
~%
1,3-bis(4-acety... CAS#:42084-03-7 |
| Literature: Dyson; George; Hunter Journal of the Chemical Society, 1927 , p. 440 |
|
~%
1,3-bis(4-acety... CAS#:42084-03-7 |
| Literature: Dyson; George; Hunter Journal of the Chemical Society, 1927 , p. 440 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N,N'-Bis-<p-acetyl-phenyl>-thioharnstoff |