PU24FCl structure
|
Common Name | PU24FCl | ||
|---|---|---|---|---|
| CAS Number | 422508-46-1 | Molecular Weight | 433.86400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H21ClFN5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PU24FClPU24FCl is a specific inhibitor of Hsp90. PU24FCl exhibits wide-ranging anti-cancer activities. PU24FCl accumulates in tumors while being rapidly cleared from normal tissue[1]. |
| Name | 8-(2-Chloro-3,4,5-trimethoxybenzyl)-2-fluoro-9-(4-pentyn-1-yl)-9H -purin-6-amine |
|---|
| Description | PU24FCl is a specific inhibitor of Hsp90. PU24FCl exhibits wide-ranging anti-cancer activities. PU24FCl accumulates in tumors while being rapidly cleared from normal tissue[1]. |
|---|---|
| Related Catalog | |
| Target |
HSP90 |
| References |
| Molecular Formula | C20H21ClFN5O3 |
|---|---|
| Molecular Weight | 433.86400 |
| Exact Mass | 433.13200 |
| PSA | 97.31000 |
| LogP | 3.81220 |
| InChIKey | KCIOVTSUEXGUFJ-UHFFFAOYSA-N |
| SMILES | C#CCCCn1c(Cc2cc(OC)c(OC)c(OC)c2Cl)nc2c(N)nc(F)nc21 |