Benzoicacid, 2-[[(4-nitrophenyl)methyl]amino]- structure
|
Common Name | Benzoicacid, 2-[[(4-nitrophenyl)methyl]amino]- | ||
|---|---|---|---|---|
| CAS Number | 42533-65-3 | Molecular Weight | 272.25600 | |
| Density | 1.403g/cm3 | Boiling Point | 500.6ºC at 760mmHg | |
| Molecular Formula | C14H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 256.6ºC | |
| Name | 2-[(4-nitrophenyl)methylamino]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.403g/cm3 |
|---|---|
| Boiling Point | 500.6ºC at 760mmHg |
| Molecular Formula | C14H12N2O4 |
| Molecular Weight | 272.25600 |
| Flash Point | 256.6ºC |
| Exact Mass | 272.08000 |
| PSA | 95.15000 |
| LogP | 3.50130 |
| Index of Refraction | 1.686 |
| InChIKey | ZQTQUKHVVMUUKP-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1NCc1ccc([N+](=O)[O-])cc1 |
|
~%
Benzoicacid, 2-... CAS#:42533-65-3 |
| Literature: Reid Journal of the American Chemical Society, 1917 , vol. 39, p. 132 |
|
~%
Benzoicacid, 2-... CAS#:42533-65-3 |
| Literature: Houben; Brassert Chemische Berichte, 1906 , vol. 39, p. 3234 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-[(4-nitrobenzyl)amino]benzoic acid |
| N-(4-Nitro-benzyl)-anthranilsaeure |
| N-(4-nitro-benzyl)-anthranilic acid |
| 2-(4-Nitro-benzylamino)-benzoesaeure |