1,3-Benzodioxolylbutanamine structure
|
Common Name | 1,3-Benzodioxolylbutanamine | ||
|---|---|---|---|---|
| CAS Number | 42542-07-4 | Molecular Weight | 193.242 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 297.3±9.0 °C at 760 mmHg | |
| Molecular Formula | C11H15NO2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 145.5±26.0 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | rac Benzodioxole-5-butanamine Ηydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 297.3±9.0 °C at 760 mmHg |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.242 |
| Flash Point | 145.5±26.0 °C |
| Exact Mass | 193.110275 |
| PSA | 44.48000 |
| LogP | 2.20 |
| Appearance of Characters | white |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.555 |
| InChIKey | LFRHMTZYADABJZ-UHFFFAOYSA-N |
| SMILES | CCC(N)Cc1ccc2c(c1)OCO2.Cl |
| Storage condition | ?20°C |
| Water Solubility | H2O: soluble |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H312-H332 |
| Precautionary Statements | P280 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn,T,F |
| Risk Phrases | 20/21/22-39/23/24/25-23/24/25-11 |
| Safety Phrases | 36-45-36/37-16-7 |
| RIDADR | UN 2811 6.1 / PGII |
|
Small RNAs derived from tRNAs and rRNAs are highly enriched in exosomes from both old and new world Leishmania providing evidence for conserved exosomal RNA Packaging.
BMC Genomics 16 , 151, (2015) Leishmania use exosomes to communicate with their mammalian hosts and these secreted vesicles appear to contribute to pathogenesis by delivering protein virulence factors to macrophages. In other euka... |
|
|
Slow and steady cell shrinkage reduces osmotic stress in bovine and murine oocyte and zygote vitrification.
Hum. Reprod. 30(1) , 37-45, (2014) Does the use of a new cryoprotectant agent (CPA) exchange protocol designed to minimize osmotic stress improve oocyte or zygote vitrification by reducing sublethal cryodamage?The use of a new CPA exch... |
|
|
Wear particles derived from metal hip implants induce the generation of multinucleated giant cells in a 3-dimensional peripheral tissue-equivalent model.
PLoS ONE 10(4) , e0124389, (2015) Multinucleate giant cells (MGCs) are formed by the fusion of 5 to 15 monocytes or macrophages. MGCs can be generated by hip implants at the site where the metal surface of the device is in close conta... |
| Benzodioxolylbutanamine |
| UNII:CM58WOT28Y |
| 1,3-Benzodioxolylbutanamine |
| (3,4-Methylenedioxyphenyl)-2-butanamine |
| 3,4-methylenedioxy-α-ethylphenethylamine |
| 1-(1,3-benzodioxol-5-yl)butan-2-amine |
| α-Ethyl-1,3-benzodioxole-5-ethanamine |
| 1-(1,3-benzodioxol-5-yl)butan-2-amine,hydrochloride |
| 1-(1,3-Benzodioxol-5-yl)-2-butanamine |
| 1,3-Benzodioxole-5-ethanamine, α-ethyl- |