1,3-Propanedione,1,3-diphenyl-2-(phenylmethylene)- structure
|
Common Name | 1,3-Propanedione,1,3-diphenyl-2-(phenylmethylene)- | ||
|---|---|---|---|---|
| CAS Number | 5398-64-1 | Molecular Weight | 312.36100 | |
| Density | 1.176g/cm3 | Boiling Point | 487.4ºC at 760mmHg | |
| Molecular Formula | C22H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 180.6ºC | |
| Name | 2-benzylidene-1,3-diphenylpropane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.176g/cm3 |
|---|---|
| Boiling Point | 487.4ºC at 760mmHg |
| Molecular Formula | C22H16O2 |
| Molecular Weight | 312.36100 |
| Flash Point | 180.6ºC |
| Exact Mass | 312.11500 |
| PSA | 34.14000 |
| LogP | 4.83580 |
| Index of Refraction | 1.647 |
| InChIKey | XWLSHEYUYYYBBQ-UHFFFAOYSA-N |
| SMILES | O=C(C(=Cc1ccccc1)C(=O)c1ccccc1)c1ccccc1 |
| HS Code | 2914399090 |
|---|
|
~92%
1,3-Propanedion... CAS#:5398-64-1 |
| Literature: Antonioletti, Roberto; Bovicelli, Paolo; Malancona, Savina Tetrahedron, 2002 , vol. 58, # 3 p. 589 - 596 |
|
~%
1,3-Propanedion... CAS#:5398-64-1 |
| Literature: Bernasconi, Claude F.; Stronach, Michael W. Journal of the American Chemical Society, 1991 , vol. 113, # 6 p. 2222 - 2227 |
|
~73%
1,3-Propanedion... CAS#:5398-64-1 |
| Literature: Singh, Kamaljit; Singh, Jasbir; Singh, Harjit Tetrahedron, 1996 , vol. 52, # 45 p. 14273 - 14280 |
| Precursor 4 | |
|---|---|
| DownStream 6 | |
| HS Code | 2914399090 |
|---|---|
| Summary | 2914399090. other aromatic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| |A-benzoylchalcone |
| 1,3-diphenyl-2-(phenylmethylene)-1,3-ropanedione |
| 2-benzylidene-1,3-diphenyl-propane-1,3-dione |
| 1-phenyl-2,2-dibenzoylethene |
| 2-benzoyl-1,3-diphenylpropenone |
| Benzylidene dibenzoylmethane |
| benzoyl-2 diphenyl-1,3 propene-2 one-1 |