H-Val-Pro-Leu-Ser-Leu-Tyr-Ser-Gly-OH trifluoroacetate salt structure
|
Common Name | H-Val-Pro-Leu-Ser-Leu-Tyr-Ser-Gly-OH trifluoroacetate salt | ||
|---|---|---|---|---|
| CAS Number | 425632-67-3 | Molecular Weight | 834.96 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C39H62N8O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of H-Val-Pro-Leu-Ser-Leu-Tyr-Ser-Gly-OH trifluoroacetate saltVPLSLYSG is an octapeptide that can be degraded by matrix metalloproteinase-9 (MMP-9), MMP-1 and MMP-2. VPLSLYSG has potential applications in MMP substrates[1][2][3]. |
| Name | H-Val-Pro-Leu-Ser-Leu-Tyr-Ser-Gly-OH trifluoroacetate salt |
|---|
| Description | VPLSLYSG is an octapeptide that can be degraded by matrix metalloproteinase-9 (MMP-9), MMP-1 and MMP-2. VPLSLYSG has potential applications in MMP substrates[1][2][3]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C39H62N8O12 |
|---|---|
| Molecular Weight | 834.96 |
| InChIKey | BBIPYBISAHJFBL-TYXFFDKISA-N |
| SMILES | CC(C)CC(NC(=O)C(CO)NC(=O)C(CC(C)C)NC(=O)C1CCCN1C(=O)C(N)C(C)C)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(CO)C(=O)NCC(=O)O.O=C(O)C(F)(F)F |