methyl 2-(3-formyl-2-methylindol-1-yl)acetate
Modify Date: 2025-08-24 19:13:52
methyl 2-(3-formyl-2-methylindol-1-yl)acetate structure
|
Common Name | methyl 2-(3-formyl-2-methylindol-1-yl)acetate | ||
|---|---|---|---|---|
| CAS Number | 431983-71-0 | Molecular Weight | 231.24700 | |
| Density | 1.18 g/cm3 | Boiling Point | 401.5ºC at 760 mmHg | |
| Molecular Formula | C13H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.6ºC | |
| Name | methyl 2-(3-formyl-2-methylindol-1-yl)acetate |
|---|
| Density | 1.18 g/cm3 |
|---|---|
| Boiling Point | 401.5ºC at 760 mmHg |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.24700 |
| Flash Point | 196.6ºC |
| Exact Mass | 231.09000 |
| PSA | 48.30000 |
| LogP | 1.93520 |
| Index of Refraction | 1.57 |
| InChIKey | GLTOPUVGYLBJTJ-UHFFFAOYSA-N |
| SMILES | COC(=O)Cn1c(C)c(C=O)c2ccccc21 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |