necrosulfonamide structure
|
Common Name | necrosulfonamide | ||
|---|---|---|---|---|
| CAS Number | 432531-71-0 | Molecular Weight | 461.472 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C18H15N5O6S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of necrosulfonamide(E/Z)-Necrosulfonamide is a racemic compound of Necrosulfonamide (HY-100573). Necrosulfonamide is a necroptosis inhibitor acting by selectively targeting the mixed lineage kinase domain-like protein (MLKL). Necrosulfonamide prevents MLKL-RIP1-RIP3 necrosome complex from interacting with its downstream effectors. MLKL is a critical substrate of RIP3 during the induction of necrosis[1][2]. |
| Name | Necrosulfonamide |
|---|---|
| Synonym | More Synonyms |
| Description | (E/Z)-Necrosulfonamide is a racemic compound of Necrosulfonamide (HY-100573). Necrosulfonamide is a necroptosis inhibitor acting by selectively targeting the mixed lineage kinase domain-like protein (MLKL). Necrosulfonamide prevents MLKL-RIP1-RIP3 necrosome complex from interacting with its downstream effectors. MLKL is a critical substrate of RIP3 during the induction of necrosis[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Molecular Formula | C18H15N5O6S2 |
| Molecular Weight | 461.472 |
| Exact Mass | 461.046387 |
| PSA | 195.95000 |
| LogP | 4.08 |
| Index of Refraction | 1.695 |
| InChIKey | FNPPHVLYVGMZMZ-XBXARRHUSA-N |
| SMILES | COc1nccnc1NS(=O)(=O)c1ccc(NC(=O)C=Cc2ccc([N+](=O)[O-])s2)cc1 |
| Hazard Codes | Xi |
|---|
| (E)-N-[4-[(3-methoxypyrazin-2-yl)sulfamoyl]phenyl]-3-(5-nitrothiophen-2-yl)prop-2-enamide |
| (2E)-N-{4-[(3-Methoxy-2-pyrazinyl)sulfamoyl]phenyl}-3-(5-nitro-2-thienyl)acrylamide |
| 2-Propenamide, N-[4-[[(3-methoxy-2-pyrazinyl)amino]sulfonyl]phenyl]-3-(5-nitro-2-thienyl)-, (2E)- |
| necrosulfonamide |