acetyl oleanolic acid structure
|
Common Name | acetyl oleanolic acid | ||
|---|---|---|---|---|
| CAS Number | 4339-72-4 | Molecular Weight | 498.737 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 564.4±50.0 °C at 760 mmHg | |
| Molecular Formula | C32H50O4 | Melting Point | 265-268 ℃ | |
| MSDS | N/A | Flash Point | 170.4±23.6 °C | |
Use of acetyl oleanolic acid3-O-Acetyloleanolic acid (3AOA), an oleanolic acid derivative isolated from the seeds of Vigna sinensis K., induces in cancer and also exhibits anti-angiogenesis activity[1]. |
| Name | 3-O-Acetyloleanolic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 3-O-Acetyloleanolic acid (3AOA), an oleanolic acid derivative isolated from the seeds of Vigna sinensis K., induces in cancer and also exhibits anti-angiogenesis activity[1]. |
|---|---|
| Related Catalog | |
| Target |
Apoptosis[1]. |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 564.4±50.0 °C at 760 mmHg |
| Melting Point | 265-268 ℃ |
| Molecular Formula | C32H50O4 |
| Molecular Weight | 498.737 |
| Flash Point | 170.4±23.6 °C |
| Exact Mass | 498.370911 |
| PSA | 63.60000 |
| LogP | 9.95 |
| Vapour Pressure | 0.0±3.3 mmHg at 25°C |
| Index of Refraction | 1.545 |
| InChIKey | RIXNFYQZWDGQAE-DFHVBEEKSA-N |
| SMILES | CC(=O)OC1CCC2(C)C(CCC3(C)C2CC=C2C4CC(C)(C)CCC4(C(=O)O)CCC23C)C1(C)C |
| Hazard Codes | Xi |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| 3-O-acetyloleanolic acid |
| acetyl oleanolic acid |
| (3β)-3-Acetoxyolean-12-en-28-oic acid |
| Oleanolic acid 3-acetate |
| Olean-12-en-28-oic acid, 3β-hydroxy-, acetate |