4-(4-chlorophenyl)-2-(methylthio)pyrimidine structure
|
Common Name | 4-(4-chlorophenyl)-2-(methylthio)pyrimidine | ||
|---|---|---|---|---|
| CAS Number | 434941-55-6 | Molecular Weight | 236.721 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 389.6±17.0 °C at 760 mmHg | |
| Molecular Formula | C11H9ClN2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.4±20.9 °C | |
| Name | 4-(4-chlorophenyl)-2-methylsulfanylpyrimidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 389.6±17.0 °C at 760 mmHg |
| Molecular Formula | C11H9ClN2S |
| Molecular Weight | 236.721 |
| Flash Point | 189.4±20.9 °C |
| Exact Mass | 236.017502 |
| PSA | 51.08000 |
| LogP | 3.49 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.648 |
| InChIKey | GOXDPARPMAHJSL-UHFFFAOYSA-N |
| SMILES | CSc1nccc(-c2ccc(Cl)cc2)n1 |
| HS Code | 2933599090 |
|---|
|
~%
4-(4-chlorophen... CAS#:434941-55-6 |
| Literature: SMITHKLINE BEECHAM CORPORATION Patent: WO2004/762 A2, 2003 ; Location in patent: Page 38 ; WO 2004/000762 A2 |
|
~%
4-(4-chlorophen... CAS#:434941-55-6 |
| Literature: Kois, Adam; MacFarlane, Karen J.; Satoh, Yoshitaka; Bhagwat, Shripad S.; Parnes, Jason S.; Palanki, Moorthy S.S.; Erdman, Paul E. Patent: US2003/203926 A1, 2003 ; US 20030203926 A1 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(4-chlorophenyl)-2-(methylthio)pyrimidine |
| Pyrimidine, 4-(4-chlorophenyl)-2-(methylthio)- |
| HMS1665F13 |
| 4-(4-Chlorophenyl)-2-(methylsulfanyl)pyrimidine |
| 4-(4-chlorophenyl)-2-methylthiopyrimidine |