4-(4-Chlorophenyl)-2-(methylsulfonyl)pyrimidine structure
|
Common Name | 4-(4-Chlorophenyl)-2-(methylsulfonyl)pyrimidine | ||
|---|---|---|---|---|
| CAS Number | 434941-56-7 | Molecular Weight | 268.719 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 479.4±37.0 °C at 760 mmHg | |
| Molecular Formula | C11H9ClN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.7±26.5 °C | |
| Name | 4-(4-chlorophenyl)-2-methylsulfonylpyrimidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 479.4±37.0 °C at 760 mmHg |
| Molecular Formula | C11H9ClN2O2S |
| Molecular Weight | 268.719 |
| Flash Point | 243.7±26.5 °C |
| Exact Mass | 268.007324 |
| PSA | 68.30000 |
| LogP | 1.42 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | ADGRYYARNGJCIR-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1nccc(-c2ccc(Cl)cc2)n1 |
| HS Code | 2933599090 |
|---|
|
~%
4-(4-Chlorophen... CAS#:434941-56-7 |
| Literature: Satoh, Yoshitaka; Bhagwat, Shripad S. Patent: US2004/106634 A1, 2004 ; US 20040106634 A1 |
|
~%
4-(4-Chlorophen... CAS#:434941-56-7 |
| Literature: ACTELION PHARMACEUTICALS LTD; AISSAOUI, Hamed; BOSS, Christoph; CIANA, Claire-Lise; SIEGRIST, Romain Patent: WO2014/72903 A1, 2014 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(4-Chlorophenyl)-2-(methylsulfonyl)pyrimidine |
| Pyrimidine, 4-(4-chlorophenyl)-2-(methylsulfonyl)- |