4,7,10,13,16-Pentaoxanonadecanedioic Acid structure
|
Common Name | 4,7,10,13,16-Pentaoxanonadecanedioic Acid | ||
|---|---|---|---|---|
| CAS Number | 439114-13-3 | Molecular Weight | 338.35100 | |
| Density | 1.205±0.06 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H26O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 4,7,10,13,16-Pentaoxanonadecanedioic AcidBis-PEG5-acid (PROTAC Linker 36) is a PROTAC linker, which belongs to a polyethylene glycol (PEG) linker. Bis-PEG5-acid (PROTAC Linker 36) can be used in the synthesis of the CP5V. CP5V is a PROTAC, and specifically degrades Cdc20[1]. |
| Name | 3-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Bis-PEG5-acid (PROTAC Linker 36) is a PROTAC linker, which belongs to a polyethylene glycol (PEG) linker. Bis-PEG5-acid (PROTAC Linker 36) can be used in the synthesis of the CP5V. CP5V is a PROTAC, and specifically degrades Cdc20[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| References |
| Density | 1.205±0.06 g/cm3 |
|---|---|
| Molecular Formula | C14H26O9 |
| Molecular Weight | 338.35100 |
| Exact Mass | 338.15800 |
| PSA | 120.75000 |
| LogP | 0.01880 |
| InChIKey | VRTJBJNTMHDBAI-UHFFFAOYSA-N |
| SMILES | O=C(O)CCOCCOCCOCCOCCOCCC(=O)O |
| Water Solubility | Freely soluble (924 g/L) (25 ºC) |
| Hazard Codes | Xn |
|---|
| Bis-PEG5-acid |
| 4,7,10,13,16-PENTAOXANONADECANE-1,19-DIOIC ACID |
| 4,7,10,13,16-Pentaoxanonadecanedioic Acid |
| bis-dPEG6-acid |
| AmbotzPEG1430 |