Bis-PEG6-t-butyl ester structure
|
Common Name | Bis-PEG6-t-butyl ester | ||
|---|---|---|---|---|
| CAS Number | 439114-12-2 | Molecular Weight | 450.56300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H42O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Bis-PEG6-t-butyl esterBis-PEG6-t-butyl ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | tert-Butyl 3-[2-(2-{2-[2-(2-tert-butoxycarbonylethoxy)ethoxy]ethoxy}ethoxy) -ethoxy]propionate |
|---|---|
| Synonym | More Synonyms |
| Description | Bis-PEG6-t-butyl ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C22H42O9 |
|---|---|
| Molecular Weight | 450.56300 |
| Exact Mass | 450.28300 |
| PSA | 98.75000 |
| LogP | 2.53300 |
| InChIKey | RYJCLSVRARTBFI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCC(=O)OC(C)(C)C |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| MFCD18916981 |