K 579 structure
|
Common Name | K 579 | ||
|---|---|---|---|---|
| CAS Number | 440100-64-1 | Molecular Weight | 328.41 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H24N6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of K 579K579 is a potent and orally active dipeptidyl peptidase IV inhibitor. K579 inhibits the blood glucose elevation. K579 increases the plasma insulin and active forms of glucagon-like peptide-1 (GLP-1). K579 has the potential for the research of diabetic[1]. |
| Name | (2S)-1-[2-[(4-methyl-1-pyrimidin-2-ylpiperidin-4-yl)amino]acetyl]pyrrolidine-2-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Description | K579 is a potent and orally active dipeptidyl peptidase IV inhibitor. K579 inhibits the blood glucose elevation. K579 increases the plasma insulin and active forms of glucagon-like peptide-1 (GLP-1). K579 has the potential for the research of diabetic[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C17H24N6O |
|---|---|
| Molecular Weight | 328.41 |
| Exact Mass | 328.20100 |
| PSA | 85.15000 |
| LogP | 1.33348 |
| InChIKey | JERPHRNGJBSFAP-AWEZNQCLSA-N |
| SMILES | CC1(NCC(=O)N2CCCC2C#N)CCN(c2ncccn2)CC1 |
| Storage condition | 2-8°C |
| UNII-74P4VV90RU |
| K-579 |
| Dipeptidylpeptidase IV Inhibitor IV,K579 |