Benzenamine, N,4-dimethyl-2-nitro structure
|
Common Name | Benzenamine, N,4-dimethyl-2-nitro | ||
|---|---|---|---|---|
| CAS Number | 4600-08-2 | Molecular Weight | 166.17700 | |
| Density | 1.212g/cm3 | Boiling Point | 292.6ºC at 760mmHg | |
| Molecular Formula | C8H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 130.8ºC | |
| Name | N,4-dimethyl-2-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.212g/cm3 |
|---|---|
| Boiling Point | 292.6ºC at 760mmHg |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.17700 |
| Flash Point | 130.8ºC |
| Exact Mass | 166.07400 |
| PSA | 57.85000 |
| LogP | 2.54110 |
| Index of Refraction | 1.605 |
| InChIKey | PQRIBMJCGDIAFK-UHFFFAOYSA-N |
| SMILES | CNc1ccc(C)cc1[N+](=O)[O-] |
| HS Code | 2921430090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 3 | |
| HS Code | 2921430090 |
|---|---|
| Summary | HS:2921430090 toluidines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4,N-dimethyl-2-nitro-aniline |
| 2-nitro-4-methyl-N-methylaminobenzene |
| Benzenamine,N,4-dimethyl-2-nitro |
| 4,N-Dimethyl-2-nitro-anilin |
| 3-Nitro-4-methylamino-toluol |