farnesol structure
|
Common Name | farnesol | ||
|---|---|---|---|---|
| CAS Number | 4602-84-0 | Molecular Weight | 222.366 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 283.4±0.0 °C at 760 mmHg | |
| Molecular Formula | C15H26O | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 96.1±0.0 °C | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
Use of farnesolFarnesol is a sesquiterpene alcohol that modulates cell-to-cell communication in Candida albicans, and has the activity in inhibiting bacteria. |
| Name | farnesol |
|---|---|
| Synonym | More Synonyms |
| Description | Farnesol is a sesquiterpene alcohol that modulates cell-to-cell communication in Candida albicans, and has the activity in inhibiting bacteria. |
|---|---|
| Related Catalog | |
| Target |
Human Endogenous Metabolite |
| In Vitro | Farnesol is a sesquiterpene alcohol that modulates cell-to-cell communication in Candida albicans. It is also shown that this molecule presents inhibitory effects against non-albicans Candida species, Paracoccidioides brasiliensis and bacteria. The minimum inhibitory concentrations (MICs) are determined in accordance with the M27-A3 protocol as described and Farnesol is tested at a concentration range of 0.29-150 μM. It is observed that Farnesol presents an inhibitory activity against C. neoformans and C. gattii (MIC range: 0.29-75.0 μM). Although Farnesol does not significantly alter phospholipase activity, a tendency to decrease this activity is observed[1]. |
| References |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 283.4±0.0 °C at 760 mmHg |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.366 |
| Flash Point | 96.1±0.0 °C |
| Exact Mass | 222.198364 |
| PSA | 20.23000 |
| LogP | 5.31 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.485 |
| InChIKey | CRDAMVZIKSXKFV-FBXUGWQNSA-N |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCO |
| Storage condition | −20°C |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents. |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H317-H319-H411 |
| Precautionary Statements | P273-P280-P333 + P313-P337 + P313-P391-P501 |
| Personal Protective Equipment | Eyeshields;Gloves;half-mask respirator (US);multi-purpose combination respirator cartridge (US) |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R24/25 |
| Safety Phrases | S22-S24/25 |
| RIDADR | UN 3082 9 / PGIII |
| WGK Germany | 3 |
| RTECS | JR4979000 |
| HS Code | 2905290000 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2905290000 |
|---|---|
| Summary | 2905290000 unsaturated monohydric alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Developmentally regulated sesquiterpene production confers resistance to Colletotrichum gloeosporioides in ripe pepper fruits.
PLoS ONE 9(10) , e109453, (2014) Sesquiterpenoid capsidiol, exhibiting antifungal activity against pathogenic fungus, is accumulated in infected ripe pepper fruits. In this study, we found a negative relation between the capsidiol le... |
|
|
Farnesol induces apoptosis-like cell death in the pathogenic fungus Aspergillus flavus.
Mycologia 106(5) , 881-8, (2014) Farnesol (FOH) is known to induce apoptosis in some fungi and mammalian cells. We treated Aspergillus flavus, one of the leading causes of human invasive aspergillosis and a key producer of the most p... |
|
|
Pluronics-Formulated Farnesol Promotes Efficient Killing and Demonstrates Novel Interactions with Streptococcus mutans Biofilms.
PLoS ONE 10 , e0133886, (2015) Streptococcus mutans is the primary causative agent of dental caries, one of the most prevalent diseases in the United States. Previously published studies have shown that Pluronic-based tooth-binding... |
| (2-trans,6-trans)-farnesol |
| (E,E)-3,7,11-Trimethyl-2,6,10-dodecatrien-1-ol |
| Stirrup-TPW |
| Stirrup-HB |
| (2E,6E)-3,7,11-Trimethyl-dodeca-2,6,10-trien-1-ol |
| trans,trans-3,7,11-Trimethyl-2,6,10-dodecatrien-1-ol |
| (2E,6E)-Farnesol |
| all-trans-farnesol |
| all-E-Farnesol |
| Farnesoi |
| EINECS 225-004-1 |
| MFCD00002918 |
| farnesyl bromide |
| 2,6,10-Dodecatrien-1-ol, 3,7,11-trimethyl-, (E,E)- |
| (2E,6E)-3,7,11-Trimethyl-2,6,10-dodecatrien-1-ol |
| trans,trans-Farnesol |
| 2,6,10-Dodecatrien-1-ol, 3,7,11-trimethyl-, (2E,6E)- |
| 3,7,10-trimethyl-2,6,10-dodecatrien-1-ol |
| ALL TRANS FARNESOL |
| FARNESOLP |
| trans-Farnesol |
| Farnesol,(E,E) |
| 3,7,11-Trimethyl-2,6,10-dodecatrienol |
| (E)-farnesol |
| farnesyl alcohol |
| (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-ol |
| 3,7,11-Trimethyl-2,6,10-Dodecatrien-1-ol |
| E,E-farnesol |
| Stirrup-CRW |
| Polyprenol |
| Stirrup-H |
| Farnesol |
| (E,E)-Farnesol |
| 3,7,11-Trimethyldodeca-2,6,10-trien-1-ol |
| 3,7,11-Trimethyldodeca-2-trans,6-trans,10-trien-1-ol |
| fci119a |
| Inhibitor A2 |