ISOPHYTOL structure
|
Common Name | ISOPHYTOL | ||
|---|---|---|---|---|
| CAS Number | 505-32-8 | Molecular Weight | 296.531 | |
| Density | 0.8±0.1 g/cm3 | Boiling Point | 327.8±10.0 °C at 760 mmHg | |
| Molecular Formula | C20H40O | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 143.5±4.7 °C | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
Use of ISOPHYTOLIsophytol is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | 3,7,11,15-tetramethylhexadec-1-en-3-ol |
|---|---|
| Synonym | More Synonyms |
| Description | Isophytol is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Density | 0.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 327.8±10.0 °C at 760 mmHg |
| Molecular Formula | C20H40O |
| Molecular Weight | 296.531 |
| Flash Point | 143.5±4.7 °C |
| Exact Mass | 296.307922 |
| PSA | 20.23000 |
| LogP | 8.28 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.456 |
| InChIKey | KEVYVLWNCKMXJX-UHFFFAOYSA-N |
| SMILES | C=CC(C)(O)CCCC(C)CCCC(C)CCCC(C)C |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility | Practically insoluble |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H410 |
| Precautionary Statements | P273-P501 |
| Personal Protective Equipment | Eyeshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S24/25-S37/39-S26 |
| RIDADR | UN 3082 9/PG 3 |
| WGK Germany | 1 |
| HS Code | 2905229000 |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 2905290000 |
|---|---|
| Summary | 2905290000 unsaturated monohydric alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Name: Luminescence-based cell-based primary high throughput screening assay to identify ago...
Source: The Scripps Research Institute Molecular Screening Center
Target: mu-type opioid receptor isoform MOR-1 [Homo sapiens]
External Id: OPRM1-OPRD1_AG_LUMI_1536_1X%ACT PRUN
|
|
Name: Fluorescence-based cell-based primary high throughput screening assay to identify ago...
Source: The Scripps Research Institute Molecular Screening Center
Target: muscarinic acetylcholine receptor M1 [Homo sapiens]
External Id: CHRM1_AG_FLUO8_1536_1X%ACT PRUN
|
|
Name: Cytochrome P450 Family 1 Subfamily A Member 2 (CYP1A2) small molecule antagonists: lu...
Source: 824
External Id: CYP273
|
|
Name: Fluorescence-based cell-based primary high throughput screening assay to identify pos...
Source: The Scripps Research Institute Molecular Screening Center
Target: muscarinic acetylcholine receptor M1 [Homo sapiens]
External Id: CHRM1_PAM_FLUO8_1536_1X%ACT PRUN
|
|
Name: Fluorescence polarization-based biochemical high throughput primary assay to identify...
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=Sialate O-acetylesterase; AltName: Full=H-Lse; AltName: Full=Sialic acid-specific 9-O-acetylesterase; Flags: Precursor [Homo sapiens]
External Id: SIAE_INH_FP_1536_1X%INH PRUN
|
|
Name: p53 small molecule agonists, cell-based qHTS assay: qHTS cell viability counter scree...
Source: 824
Target: N/A
External Id: P53600
|
|
Name: p53 small molecule agonists, cell-based qHTS assay with rat liver microsomes: qHTS ce...
Source: 824
Target: N/A
External Id: P53MS958
|
|
Name: p53 small molecule agonists, cell-based qHTS assay with rat liver microsomes: Summary
Source: 824
External Id: P53MS482
|
|
Name: p53 small molecule agonists, cell-based qHTS assay with human liver microsomes
Source: 824
Target: tumor suppressor p53 [Homo sapiens]
External Id: P53MS233
|
| ISOPHYTOL |
| 2,6,10-Trimethyl-14-vinylpentadecan-14-ol |
| MFCD00048380 |
| 1-Hexadecene-3-ol, 3,7,11,15-tetramethyl |
| 3,7,11,15-Tetramethyl-1-hexadecen-3-ol |
| 3,7,11,15-tetramethylhexadec-1-en-3-ol |
| 3,7,11,15-tetramethylhexadeca-1-en-3-ol |
| UNII:A831ZI6VIM |
| EINECS 208-008-8 |
| 1-Hexadecen-3-ol,3,7,11,15-tetramethyl |